Difference between revisions of "RXN-11374"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14673 CPD-14673] == * smiles: ** C(#N)CCC1(C=CC=CC=1) * inchi key: ** InChIKey=ACRWYXSKEHUQ...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11374 RXN-11374] == * direction: ** LEFT-TO-RIGHT * common name: ** diphthine_synthase * Synony...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14673 CPD-14673] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11374 RXN-11374] ==
* smiles:
+
* direction:
** C(#N)CCC1(C=CC=CC=1)
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=ACRWYXSKEHUQDB-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** 3-phenylpropionitrile
+
** diphthine_synthase
* molecular weight:
+
** 131.177   
+
 
* Synonym(s):
 
* Synonym(s):
** benzenepropanenitrile
 
** 2-phenylethyl cyanide
 
** 3-phenylpropanonitril
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-18229]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[2-3-CARBOXY-3-METHYLAMMONIOPROPYL-L-]][c] '''=>''' 1 [[3-carboxy-3-dimethylammonio-propyl-L-his]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 S-adenosyl-L-methionine[c] '''+''' 1 a 2-[(3S)-3-carboxy-3-(methylammonio)propyl]-L-histidine-[translation elongation factor 2][c] '''=>''' 1 a 2-[(3S)-3-carboxy-3-(dimethylammonio)propyl]-L-histidine-[translation elongation factor 2][c] '''+''' 1 H+[c] '''+''' 1 S-adenosyl-L-homocysteine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_15743]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* LIGAND-RXN:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12581 12581]
+
** [http://www.genome.jp/dbget-bin/www_bget?R08468 R08468]
* CHEMSPIDER:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.chemspider.com/Chemical-Structure.12061.html 12061]
+
{{#set: common name=diphthine_synthase}}
* CHEBI:
+
{{#set: gene associated=Tiso_gene_15743}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=85426 85426]
+
{{#set: in pathway=}}
* HMDB : HMDB34236
+
{{#set: reconstruction category=orthology|annotation}}
{{#set: smiles=C(#N)CCC1(C=CC=CC=1)}}
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
{{#set: inchi key=InChIKey=ACRWYXSKEHUQDB-UHFFFAOYSA-N}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
{{#set: common name=3-phenylpropionitrile}}
+
{{#set: molecular weight=131.177    }}
+
{{#set: common name=benzenepropanenitrile|2-phenylethyl cyanide|3-phenylpropanonitril}}
+
{{#set: consumed by=RXN-18229}}
+

Latest revision as of 21:04, 21 March 2018

Reaction RXN-11374

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • diphthine_synthase
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links