Difference between revisions of "CPD-13010"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_2848 == * Synonym(s): == Reactions associated == * GGPS ** pantograph-creinhardtii * GPPS ** pantograph-creinhardtii...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13010 CPD-13010] == * smiles: ** C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C=C2)O)))[N+])([O-])=O * c...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13010 CPD-13010] == |
| + | * smiles: | ||
| + | ** C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C=C2)O)))[N+])([O-])=O | ||
| + | * common name: | ||
| + | ** 3'-monoiodothyronine | ||
| + | * inchi key: | ||
| + | ** InChIKey=RUIUIJSMLKJUDC-ZDUSSCGKSA-N | ||
| + | * molecular weight: | ||
| + | ** 399.184 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** L-tyrosine, O-(4-hydroxy-3-iodophenyl)- | ||
| + | ** 3'-T1 | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-12037]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986170 50986170] |
| + | {{#set: smiles=C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C=C2)O)))[N+])([O-])=O}} | ||
| + | {{#set: common name=3'-monoiodothyronine}} | ||
| + | {{#set: inchi key=InChIKey=RUIUIJSMLKJUDC-ZDUSSCGKSA-N}} | ||
| + | {{#set: molecular weight=399.184 }} | ||
| + | {{#set: common name=L-tyrosine, O-(4-hydroxy-3-iodophenyl)-|3'-T1}} | ||
| + | {{#set: produced by=RXN-12037}} | ||
Latest revision as of 21:04, 21 March 2018
Contents
Metabolite CPD-13010
- smiles:
- C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C=C2)O)))[N+])([O-])=O
- common name:
- 3'-monoiodothyronine
- inchi key:
- InChIKey=RUIUIJSMLKJUDC-ZDUSSCGKSA-N
- molecular weight:
- 399.184
- Synonym(s):
- L-tyrosine, O-(4-hydroxy-3-iodophenyl)-
- 3'-T1
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C=C2)O)))[N+])([O-])=O" cannot be used as a page name in this wiki.
