Difference between revisions of "Tiso gene 6812"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13010 CPD-13010] == * smiles: ** C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C=C2)O)))[N+])([O-])=O * i...")
 
(Created page with "Category:Gene == Gene Tiso_gene_6812 == * Synonym(s): == Reactions associated == * Reaction: DNA-DIRECTED-RNA-POLYMERASE-RXN ** Source: annotation-experimental_anno...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13010 CPD-13010] ==
+
== Gene Tiso_gene_6812 ==
* smiles:
+
** C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C=C2)O)))[N+])([O-])=O
+
* inchi key:
+
** InChIKey=RUIUIJSMLKJUDC-ZDUSSCGKSA-N
+
* common name:
+
** 3'-monoiodothyronine
+
* molecular weight:
+
** 399.184   
+
 
* Synonym(s):
 
* Synonym(s):
** L-tyrosine, O-(4-hydroxy-3-iodophenyl)-
 
** 3'-T1
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
* [[RXN-12037]]
+
** Source: [[annotation-experimental_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=DNA-DIRECTED-RNA-POLYMERASE-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986170 50986170]
+
{{#set: smiles=C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C=C2)O)))[N+])([O-])=O}}
+
{{#set: inchi key=InChIKey=RUIUIJSMLKJUDC-ZDUSSCGKSA-N}}
+
{{#set: common name=3'-monoiodothyronine}}
+
{{#set: molecular weight=399.184    }}
+
{{#set: common name=L-tyrosine, O-(4-hydroxy-3-iodophenyl)-|3'-T1}}
+
{{#set: produced by=RXN-12037}}
+

Latest revision as of 20:04, 21 March 2018

Gene Tiso_gene_6812

  • Synonym(s):

Reactions associated

Pathways associated

External links