Difference between revisions of "5-HYDROXY-CTP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7676 RXN-7676] == * direction: ** LEFT-TO-RIGHT * common name: ** chlorophyllide-a monooxygenas...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-CTP 5-HYDROXY-CTP] == * smiles: ** C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7676 RXN-7676] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-CTP 5-HYDROXY-CTP] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O
 
* common name:
 
* common name:
−
** chlorophyllide-a monooxygenase
+
** 5-hydroxy-CTP
−
** rieske_2fe-2sdomainiss
+
* inchi key:
−
** tic55_component_of_chloroplast_import_machinery
+
** InChIKey=DMFODUNDODUQKK-UAKXSSHOSA-J
−
** isp_domain-containing_protein
+
* molecular weight:
 +
** 495.126   
 
* Synonym(s):
 
* Synonym(s):
−
** chlorophyllide a oxygenase
+
** 5-hydroxycytidine triphosphate
−
** chlorophyll-b synthase
+
−
** CAO
+
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[PROTON]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[CHLOROPHYLLIDE-A]][c] '''=>''' 1 [[CPD-7015]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[NADP]][c]
+
* [[RXN0-7080]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H+[c] '''+''' 1 oxygen[c] '''+''' 1 NADPH[c] '''+''' 1 chlorophyllide a[c] '''=>''' 1 71-hydroxychlorophyllide a[c] '''+''' 1 H2O[c] '''+''' 1 NADP+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_152]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_4002]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_12611]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_8091]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_13817]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-5068]], chlorophyll cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5068 PWY-5068]
+
−
** '''4''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22676 22676]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202584 25202584]
−
* LIGAND-RXN:
+
{{#set: smiles=C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R08203 R08203]
+
{{#set: common name=5-hydroxy-CTP}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: inchi key=InChIKey=DMFODUNDODUQKK-UAKXSSHOSA-J}}
−
{{#set: common name=chlorophyllide-a monooxygenase}}
+
{{#set: molecular weight=495.126    }}
−
{{#set: common name=rieske_2fe-2sdomainiss}}
+
{{#set: common name=5-hydroxycytidine triphosphate}}
−
{{#set: common name=tic55_component_of_chloroplast_import_machinery}}
+
{{#set: produced by=RXN0-7080}}
−
{{#set: common name=isp_domain-containing_protein}}
+
−
{{#set: common name=chlorophyllide a oxygenase|chlorophyll-b synthase|CAO}}
+
−
{{#set: gene associated=Tiso_gene_152|Tiso_gene_4002|Tiso_gene_12611|Tiso_gene_8091|Tiso_gene_13817}}
+
−
{{#set: in pathway=PWY-5068}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=esiliculosus}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=in-silico_annotation}}
+

Latest revision as of 21:04, 21 March 2018

Metabolite 5-HYDROXY-CTP

  • smiles:
    • C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O
  • common name:
    • 5-hydroxy-CTP
  • inchi key:
    • InChIKey=DMFODUNDODUQKK-UAKXSSHOSA-J
  • molecular weight:
    • 495.126
  • Synonym(s):
    • 5-hydroxycytidine triphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=5-HYDROXY-CTP&oldid=45717"