Difference between revisions of "CPD-4203"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEHYDROQUINATE DEHYDROQUINATE] == * smiles: ** C1(C(O)C(O)C(=O)CC(O)(C([O-])=O)1) * inchi key:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4203 CPD-4203] == * smiles: ** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])[O-])([O-])=...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4203 CPD-4203] == |
* smiles: | * smiles: | ||
− | ** C1(C( | + | ** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])[O-])([O-])=O)O)O))C=NC=23)))C |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** N6-(Δ2-isopentenyl)-adenosine 5'-diphosphate |
+ | * inchi key: | ||
+ | ** InChIKey=VXMXKDAHJURHEN-SDBHATRESA-K | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 492.298 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** iPDP |
− | ** | + | ** isopentenyladenosine riboside-5'-diphosphate |
− | + | ** iPRDP | |
− | ** | + | ** isopentenyladenosine-5'-diphosphate |
− | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[RXN-4305]] | |
− | * [[RXN- | + | |
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202829 25202829] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73533 73533] |
− | * | + | * LIGAND-CPD: |
− | {{#set: smiles=C1(C( | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16426 C16426] |
− | {{#set: | + | {{#set: smiles=CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])[O-])([O-])=O)O)O))C=NC=23)))C}} |
− | {{#set: | + | {{#set: common name=N6-(Δ2-isopentenyl)-adenosine 5'-diphosphate}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=VXMXKDAHJURHEN-SDBHATRESA-K}} |
− | {{#set: common name= | + | {{#set: molecular weight=492.298 }} |
− | {{#set: produced by= | + | {{#set: common name=iPDP|isopentenyladenosine riboside-5'-diphosphate|iPRDP|isopentenyladenosine-5'-diphosphate}} |
− | + | {{#set: produced by=RXN-4305}} |
Latest revision as of 20:04, 21 March 2018
Contents
Metabolite CPD-4203
- smiles:
- CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])[O-])([O-])=O)O)O))C=NC=23)))C
- common name:
- N6-(Δ2-isopentenyl)-adenosine 5'-diphosphate
- inchi key:
- InChIKey=VXMXKDAHJURHEN-SDBHATRESA-K
- molecular weight:
- 492.298
- Synonym(s):
- iPDP
- isopentenyladenosine riboside-5'-diphosphate
- iPRDP
- isopentenyladenosine-5'-diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])[O-])([O-])=O)O)O))C=NC=23)))C" cannot be used as a page name in this wiki.