Difference between revisions of "CPD-4203"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-349 RXN1G-349] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxoacyl-(acyl-carrier-pro...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4203 CPD-4203] == * smiles: ** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])[O-])([O-])=...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-349 RXN1G-349] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4203 CPD-4203] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])[O-])([O-])=O)O)O))C=NC=23)))C
 
* common name:
 
* common name:
−
** 3-oxoacyl-(acyl-carrier-protein)
+
** N6-(Δ2-isopentenyl)-adenosine 5'-diphosphate
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.1.1.100 EC-1.1.1.100]
+
** InChIKey=VXMXKDAHJURHEN-SDBHATRESA-K
 +
* molecular weight:
 +
** 492.298   
 
* Synonym(s):
 
* Synonym(s):
 +
** iPDP
 +
** isopentenyladenosine riboside-5'-diphosphate
 +
** iPRDP
 +
** isopentenyladenosine-5'-diphosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[3-oxo-arachidoyl-ACPs]][c] '''=>''' 1 [[R-3-hydroxyarachidoyl-ACPs]][c] '''+''' 1 [[NADP]][c]
+
* [[RXN-4305]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H+[c] '''+''' 1 NADPH[c] '''+''' 1 a 3-oxo-arachidoyl-[acp][c] '''=>''' 1 a (3R)-3-hydroxyarachidoyl-[acp][c] '''+''' 1 NADP+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_13083]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***EC-NUMBER
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_9885]]
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
+
−
** '''86''' reactions found over '''182''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[manual]]
+
−
** Source: [[manual-primary_network]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=3-oxoacyl-(acyl-carrier-protein)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202829 25202829]
−
{{#set: ec number=EC-1.1.1.100}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_13083|Tiso_gene_9885}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73533 73533]
−
{{#set: in pathway=PWYG-321}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=orthology|manual|annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C16426 C16426]
−
{{#set: reconstruction source=annotation-in-silico_annotation|manual-primary_network|annotation-experimental_annotation|orthology-esiliculosus}}
+
{{#set: smiles=CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])[O-])([O-])=O)O)O))C=NC=23)))C}}
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+
{{#set: common name=N6-(Δ2-isopentenyl)-adenosine 5'-diphosphate}}
 +
{{#set: inchi key=InChIKey=VXMXKDAHJURHEN-SDBHATRESA-K}}
 +
{{#set: molecular weight=492.298    }}
 +
{{#set: common name=iPDP|isopentenyladenosine riboside-5'-diphosphate|iPRDP|isopentenyladenosine-5'-diphosphate}}
 +
{{#set: produced by=RXN-4305}}

Latest revision as of 21:04, 21 March 2018

Metabolite CPD-4203

  • smiles:
    • CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])[O-])([O-])=O)O)O))C=NC=23)))C
  • common name:
    • N6-(Δ2-isopentenyl)-adenosine 5'-diphosphate
  • inchi key:
    • InChIKey=VXMXKDAHJURHEN-SDBHATRESA-K
  • molecular weight:
    • 492.298
  • Synonym(s):
    • iPDP
    • isopentenyladenosine riboside-5'-diphosphate
    • iPRDP
    • isopentenyladenosine-5'-diphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])[O-])([O-])=O)O)O))C=NC=23)))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-4203&oldid=45720"