Difference between revisions of "PGCM"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL PHENYL] == * smiles: ** CC(=O)C1(C=CC=CC=1) * inchi key: ** InChIKey=KWOLFJPFCHCOCG-UHFF...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PGCM PGCM] == * direction: ** REVERSIBLE * common name: ** phosphoglucomutase * Synonym(s): == Rea...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL PHENYL] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PGCM PGCM] ==
* smiles:
+
* direction:
** CC(=O)C1(C=CC=CC=1)
+
** REVERSIBLE
* inchi key:
+
** InChIKey=KWOLFJPFCHCOCG-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** acetophenone
+
** phosphoglucomutase
* molecular weight:
+
** 120.151   
+
 
* Synonym(s):
 
* Synonym(s):
** phenylmethylketone
 
** methylphenylketone
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1.0 [[GLC-1-P]][c] '''<=>''' 1.0 [[ALPHA-GLC-6-P]][c]
* [[RXN-1302]]
+
* With common name(s):
 +
** 1.0 &alpha;-D-glucopyranose 1-phosphate[c] '''<=>''' 1.0 &alpha;-D-glucose 6-phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_13477]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_4816]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* CAS : 98-86-2
+
{{#set: direction=REVERSIBLE}}
* DRUGBANK : DB04619
+
{{#set: common name=phosphoglucomutase}}
* PUBCHEM:
+
{{#set: gene associated=Tiso_gene_13477|Tiso_gene_4816}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7410 7410]
+
{{#set: in pathway=}}
* HMDB : HMDB33910
+
{{#set: reconstruction category=orthology}}
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-creinhardtii}}
** [http://www.genome.jp/dbget-bin/www_bget?C07113 C07113]
+
{{#set: reconstruction tool=pantograph}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.7132.html 7132]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27632 27632]
+
{{#set: smiles=CC(=O)C1(C=CC=CC=1)}}
+
{{#set: inchi key=InChIKey=KWOLFJPFCHCOCG-UHFFFAOYSA-N}}
+
{{#set: common name=acetophenone}}
+
{{#set: molecular weight=120.151    }}
+
{{#set: common name=phenylmethylketone|methylphenylketone}}
+
{{#set: consumed or produced by=RXN-1302}}
+

Latest revision as of 20:04, 21 March 2018

Reaction PGCM

  • direction:
    • REVERSIBLE
  • common name:
    • phosphoglucomutase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 α-D-glucopyranose 1-phosphate[c] <=> 1.0 α-D-glucose 6-phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links