Difference between revisions of "Tiso gene 16455"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-318 CPD-318] == * smiles: ** C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1) * inchi key: ** InChIKey=LHFJO...") |
(Created page with "Category:Gene == Gene Tiso_gene_16455 == * Synonym(s): == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-athaliana ** Source: orthology-esili...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_16455 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[RXN-8443]] |
− | * [[ | + | ** Source: [[orthology-athaliana]] |
− | + | ** Source: [[orthology-esiliculosus]] | |
− | * [[ | + | == Pathways associated == |
− | * [[ | + | * [[PWY-5381]] |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=RXN-8443}} | |
− | + | {{#set: pathway associated=PWY-5381}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Latest revision as of 21:04, 21 March 2018
Gene Tiso_gene_16455
- Synonym(s):
Reactions associated
- Reaction: RXN-8443
- Source: orthology-athaliana
- Source: orthology-esiliculosus