Difference between revisions of "UNDECAPRENYL-DIPHOSPHATE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=6.3.4.10-RXN 6.3.4.10-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.o...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UNDECAPRENYL-DIPHOSPHATE UNDECAPRENYL-DIPHOSPHATE] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(C)=CCCC...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UNDECAPRENYL-DIPHOSPHATE UNDECAPRENYL-DIPHOSPHATE] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP([O-])(=O)OP(=O)([O-])[O-])C)C)C |
− | * | + | * common name: |
− | ** | + | ** di-trans,octa-cis-undecaprenyl diphosphate |
+ | * inchi key: | ||
+ | ** InChIKey=NTXGVHCCXVHYCL-NTDVEAECSA-K | ||
+ | * molecular weight: | ||
+ | ** 924.251 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** di-trans-poly-cis-undecaprenyl diphosphate | ||
+ | ** undecaprenyl-PP (ambiguous) | ||
+ | ** bactoprenyl pyrophosphate | ||
+ | ** undecaprenyl pyrophosphate (ambiguous) | ||
+ | ** UPP (ambiguous) | ||
+ | ** di-trans,octa-cis-undecaprenyl diphosphate | ||
+ | ** C55-PP | ||
+ | ** Und-PP | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-8999]] | |
− | + | * [[RXN-11351]] | |
− | + | * [[RXN-11065]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * PUBCHEM: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245563 25245563] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58405 58405] |
− | {{#set: | + | * BIGG : udcpdp |
− | + | * LIGAND-CPD: | |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04574 C04574] |
− | {{#set: | + | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP([O-])(=O)OP(=O)([O-])[O-])C)C)C}} |
− | {{#set: | + | {{#set: common name=di-trans,octa-cis-undecaprenyl diphosphate}} |
+ | {{#set: inchi key=InChIKey=NTXGVHCCXVHYCL-NTDVEAECSA-K}} | ||
+ | {{#set: molecular weight=924.251 }} | ||
+ | {{#set: common name=di-trans-poly-cis-undecaprenyl diphosphate|undecaprenyl-PP (ambiguous)|bactoprenyl pyrophosphate|undecaprenyl pyrophosphate (ambiguous)|UPP (ambiguous)|di-trans,octa-cis-undecaprenyl diphosphate|C55-PP|Und-PP}} | ||
+ | {{#set: produced by=RXN-8999|RXN-11351|RXN-11065}} |
Latest revision as of 20:04, 21 March 2018
Contents
Metabolite UNDECAPRENYL-DIPHOSPHATE
- smiles:
- CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP([O-])(=O)OP(=O)([O-])[O-])C)C)C
- common name:
- di-trans,octa-cis-undecaprenyl diphosphate
- inchi key:
- InChIKey=NTXGVHCCXVHYCL-NTDVEAECSA-K
- molecular weight:
- 924.251
- Synonym(s):
- di-trans-poly-cis-undecaprenyl diphosphate
- undecaprenyl-PP (ambiguous)
- bactoprenyl pyrophosphate
- undecaprenyl pyrophosphate (ambiguous)
- UPP (ambiguous)
- di-trans,octa-cis-undecaprenyl diphosphate
- C55-PP
- Und-PP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP([O-])(=O)OP(=O)([O-])[O-])C)C)C" cannot be used as a page name in this wiki.