Difference between revisions of "R05068"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE-P THIAMINE-P] == * smiles: ** CC1([N+](=CSC(CCOP([O-])(=O)[O-])=1)CC2(C=NC(C)=NC(N)=2)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R05068 R05068] == * direction: ** LEFT-TO-RIGHT * common name: ** R289 * Synonym(s): == Reaction F...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE-P THIAMINE-P] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R05068 R05068] ==
* smiles:
+
* direction:
** CC1([N+](=CSC(CCOP([O-])(=O)[O-])=1)CC2(C=NC(C)=NC(N)=2))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=HZSAJDVWZRBGIF-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** thiamine phosphate
+
** R289
* molecular weight:
+
** 343.317   
+
 
* Synonym(s):
 
* Synonym(s):
** TMP
 
** thiamin monophosphate
 
** thiamin phosphate
 
** thiamin-P
 
** thiamine-Pi
 
** ThP
 
** thiamine monophosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXNQT-4191]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[CPD-15104]][c] '''+''' 1.0 [[NADPH]][c] '''+''' 1.0 [[PROTON]][c] '''=>''' 1.0 [[NADP]][c] '''+''' 1.0 [[1-KETO-2-METHYLVALERATE]][c]
* [[THI-P-SYN-RXN]]
+
* With common name(s):
* [[RXN-12610]]
+
** 1.0 (R)-3-hydroxy-3-methyl-2-oxopentanoate[c] '''+''' 1.0 NADPH[c] '''+''' 1.0 H+[c] '''=>''' 1.0 NADP+[c] '''+''' 1.0 (R)-2,3-dihydroxy-3-methylpentanoate[c]
* [[RXN-12611]]
+
 
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
* [[RXN0-3542]]
+
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_10174]]
 +
** Source: [[orthology-synechocystis]]
 +
* Gene: [[Tiso_gene_10173]]
 +
** Source: [[orthology-synechocystis]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* CAS : 532-40-1
+
{{#set: direction=LEFT-TO-RIGHT}}
* METABOLIGHTS : MTBLC37575
+
{{#set: common name=R289}}
* PUBCHEM:
+
{{#set: gene associated=Tiso_gene_10174|Tiso_gene_10173}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15942892 15942892]
+
{{#set: in pathway=}}
* HMDB : HMDB02666
+
{{#set: reconstruction category=orthology}}
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-synechocystis}}
** [http://www.genome.jp/dbget-bin/www_bget?C01081 C01081]
+
{{#set: reconstruction tool=pantograph}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.13085545.html 13085545]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=37575 37575]
+
* BIGG : thmmp
+
{{#set: smiles=CC1([N+](=CSC(CCOP([O-])(=O)[O-])=1)CC2(C=NC(C)=NC(N)=2))}}
+
{{#set: inchi key=InChIKey=HZSAJDVWZRBGIF-UHFFFAOYSA-M}}
+
{{#set: common name=thiamine phosphate}}
+
{{#set: molecular weight=343.317    }}
+
{{#set: common name=TMP|thiamin monophosphate|thiamin phosphate|thiamin-P|thiamine-Pi|ThP|thiamine monophosphate}}
+
{{#set: consumed by=RXNQT-4191}}
+
{{#set: produced by=THI-P-SYN-RXN|RXN-12610|RXN-12611}}
+
{{#set: reversible reaction associated=RXN0-3542}}
+

Latest revision as of 20:05, 21 March 2018

Reaction R05068

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • R289
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 (R)-3-hydroxy-3-methyl-2-oxopentanoate[c] + 1.0 NADPH[c] + 1.0 H+[c] => 1.0 NADP+[c] + 1.0 (R)-2,3-dihydroxy-3-methylpentanoate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links