Difference between revisions of "Tiso gene 17748"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CH33ADO CH33ADO] == * smiles: ** CC1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23))) * common name: ** 5...") |
(Created page with "Category:Gene == Gene Tiso_gene_17748 == * Synonym(s): == Reactions associated == * Reaction: ADCLY-RXN ** Source: orthology-athaliana ** Source: orthology-esil...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_17748 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[ADCLY-RXN]] | |
− | * [[ | + | ** Source: [[orthology-athaliana]] |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | * [[ | + | ** Source: [[orthology-creinhardtii]] |
− | * [[RXN- | + | * Reaction: [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]] |
− | * [[ | + | ** Source: [[orthology-athaliana]] |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | * [[ | + | == Pathways associated == |
− | * [[ | + | * [[ILEUSYN-PWY]] |
− | * [[ | + | * [[ILEUDEG-PWY]] |
− | * [[ | + | * [[PWY-5108]] |
− | * [[ | + | * [[PWY-5103]] |
− | + | * [[PWY-5101]] | |
+ | * [[PWY-5078]] | ||
+ | * [[PWY-6543]] | ||
+ | * [[PWY-5104]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=ADCLY-RXN|BRANCHED-CHAINAMINOTRANSFERILEU-RXN}} | |
− | + | {{#set: pathway associated=ILEUSYN-PWY|ILEUDEG-PWY|PWY-5108|PWY-5103|PWY-5101|PWY-5078|PWY-6543|PWY-5104}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 21:05, 21 March 2018
Gene Tiso_gene_17748
- Synonym(s):
Reactions associated
- Reaction: ADCLY-RXN
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Reaction: BRANCHED-CHAINAMINOTRANSFERILEU-RXN
- Source: orthology-athaliana
- Source: orthology-esiliculosus