Difference between revisions of "CPD-12015"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-PHOSPHATIDYL-ETHANOLAMINE L-1-PHOSPHATIDYL-ETHANOLAMINE] == * common name: ** an L-1-phosph...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12015 CPD-12015] == * smiles: ** CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2)) * com...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-PHOSPHATIDYL-ETHANOLAMINE L-1-PHOSPHATIDYL-ETHANOLAMINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12015 CPD-12015] ==
 +
* smiles:
 +
** CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))
 
* common name:
 
* common name:
−
** an L-1-phosphatidylethanolamine
+
** 6-sulfatoxymelatonin
 +
* inchi key:
 +
** InChIKey=QQEILXDLZRLTME-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 327.331   
 
* Synonym(s):
 
* Synonym(s):
−
** a glycerophosphoethanolamine
+
** 6-sulphatoxymelatonin
−
** a phosphatidylethanolamine
+
** 6-hydroxymelatoninsulfate
−
** a 1-phosphatidylethanolamine
+
** 6-hydroxymelatonin sulfate ester
−
** an L-1-phosphotidylethanolamine
+
** acetamide, N-(2-(5-methoxy-6-(sulfooxy)-1H-indol-3-yl)ethyl)-
−
** a phosphatidylethenolamine
+
−
** an O-(1-β-acyl-2-acyl-sn-glycero-3-phospho)-ethanolamine
+
−
** PtdEtn
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN0-6725]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[PHOSPHASERDECARB-RXN]]
+
* [[RXN-11058]]
−
* [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]]
+
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
{{#set: common name=an L-1-phosphatidylethanolamine}}
+
* PUBCHEM:
−
{{#set: common name=a glycerophosphoethanolamine|a phosphatidylethanolamine|a 1-phosphatidylethanolamine|an L-1-phosphotidylethanolamine|a phosphatidylethenolamine|an O-(1-β-acyl-2-acyl-sn-glycero-3-phospho)-ethanolamine|PtdEtn}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=38988602 38988602]
−
{{#set: consumed by=RXN0-6725}}
+
* CHEMSPIDER:
−
{{#set: produced by=PHOSPHASERDECARB-RXN|ETHANOLAMINEPHOSPHOTRANSFERASE-RXN}}
+
** [http://www.chemspider.com/Chemical-Structure.58606.html 58606]
 +
* HMDB : HMDB41815
 +
{{#set: smiles=CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))}}
 +
{{#set: common name=6-sulfatoxymelatonin}}
 +
{{#set: inchi key=InChIKey=QQEILXDLZRLTME-UHFFFAOYSA-M}}
 +
{{#set: molecular weight=327.331    }}
 +
{{#set: common name=6-sulphatoxymelatonin|6-hydroxymelatoninsulfate|6-hydroxymelatonin sulfate ester|acetamide, N-(2-(5-methoxy-6-(sulfooxy)-1H-indol-3-yl)ethyl)-}}
 +
{{#set: produced by=RXN-11058}}

Latest revision as of 20:05, 21 March 2018

Metabolite CPD-12015

  • smiles:
    • CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))
  • common name:
    • 6-sulfatoxymelatonin
  • inchi key:
    • InChIKey=QQEILXDLZRLTME-UHFFFAOYSA-M
  • molecular weight:
    • 327.331
  • Synonym(s):
    • 6-sulphatoxymelatonin
    • 6-hydroxymelatoninsulfate
    • 6-hydroxymelatonin sulfate ester
    • acetamide, N-(2-(5-methoxy-6-(sulfooxy)-1H-indol-3-yl)ethyl)-

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-12015&oldid=45783"