Difference between revisions of "Tiso gene 18780"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12015 CPD-12015] == * smiles: ** CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2)) * inc...")
 
(Created page with "Category:Gene == Gene Tiso_gene_18780 == * right end position: ** 2765 * transcription direction: ** POSITIVE * left end position: ** 3 * centisome position: ** 0.10710461...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12015 CPD-12015] ==
+
== Gene Tiso_gene_18780 ==
−
* smiles:
+
* right end position:
−
** CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))
+
** 2765
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QQEILXDLZRLTME-UHFFFAOYSA-M
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 6-sulfatoxymelatonin
+
** 3
−
* molecular weight:
+
* centisome position:
−
** 327.331    
+
** 0.107104614    
 
* Synonym(s):
 
* Synonym(s):
−
** 6-sulphatoxymelatonin
 
−
** 6-hydroxymelatoninsulfate
 
−
** 6-hydroxymelatonin sulfate ester
 
−
** acetamide, N-(2-(5-methoxy-6-(sulfooxy)-1H-indol-3-yl)ethyl)-
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ATPASE-RXN]]
−
* [[RXN-11058]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2765}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=38988602 38988602]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEMSPIDER:
+
{{#set: left end position=3}}
−
** [http://www.chemspider.com/Chemical-Structure.58606.html 58606]
+
{{#set: centisome position=0.107104614   }}
−
* HMDB : HMDB41815
+
{{#set: reaction associated=ATPASE-RXN}}
−
{{#set: smiles=CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))}}
+
−
{{#set: inchi key=InChIKey=QQEILXDLZRLTME-UHFFFAOYSA-M}}
+
−
{{#set: common name=6-sulfatoxymelatonin}}
+
−
{{#set: molecular weight=327.331   }}
+
−
{{#set: common name=6-sulphatoxymelatonin|6-hydroxymelatoninsulfate|6-hydroxymelatonin sulfate ester|acetamide, N-(2-(5-methoxy-6-(sulfooxy)-1H-indol-3-yl)ethyl)-}}
+
−
{{#set: produced by=RXN-11058}}
+

Latest revision as of 21:05, 21 March 2018

Gene Tiso_gene_18780

  • right end position:
    • 2765
  • transcription direction:
    • POSITIVE
  • left end position:
    • 3
  • centisome position:
    • 0.107104614
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18780&oldid=45784"