Difference between revisions of "RXN1G-409"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_12148 == * left end position: ** 2173 * transcription direction: ** NEGATIVE * right end position: ** 6488 * centisome position: ** 29.9270...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-409 RXN1G-409] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-409 RXN1G-409] == |
− | * | + | * direction: |
− | + | ** LEFT-TO-RIGHT | |
− | + | * ec number: | |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.1.1.M9 EC-1.1.1.M9] |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[cis-cis-D19-37-3-oxo-C56-2-ACPs]][c] '''=>''' 1 [[cis-cis-D19-37-3-hydroxyC56-2-ACPs]][c] '''+''' 1 [[NADP]][c] | |
− | + | * With common name(s): | |
− | + | ** 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 a cis,cis-delta19,37-3-oxo-C56:2-[acp][c] '''=>''' 1 a cis,cis-delta19,37-3-hydroxy-C56:2-[acp][c] '''+''' 1 NADP+[c] | |
− | * | + | |
− | ** | + | == Genes associated with this reaction == |
− | + | Genes have been associated with this reaction based on different elements listed below. | |
− | + | * Gene: [[Tiso_gene_13083]] | |
− | + | ** Source: [[orthology-esiliculosus]] | |
− | + | == Pathways == | |
− | + | * [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321] | |
− | + | ** '''86''' reactions found over '''182''' reactions in the full pathway | |
− | * [[ | + | == Reconstruction information == |
− | ** | + | * Category: [[orthology]] |
− | + | ** Source: [[orthology-esiliculosus]] | |
− | == Pathways | + | *** Tool: [[pantograph]] |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: ec number=EC-1.1.1.M9}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_13083}} |
− | {{#set: | + | {{#set: in pathway=PWYG-321}} |
− | {{#set: | + | {{#set: reconstruction category=orthology}} |
− | {{#set: | + | {{#set: reconstruction source=orthology-esiliculosus}} |
+ | {{#set: reconstruction tool=pantograph}} |
Latest revision as of 20:05, 21 March 2018
Contents
Reaction RXN1G-409
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NADPH[c] + 1 PROTON[c] + 1 cis-cis-D19-37-3-oxo-C56-2-ACPs[c] => 1 cis-cis-D19-37-3-hydroxyC56-2-ACPs[c] + 1 NADP[c]
- With common name(s):
- 1 NADPH[c] + 1 H+[c] + 1 a cis,cis-delta19,37-3-oxo-C56:2-[acp][c] => 1 a cis,cis-delta19,37-3-hydroxy-C56:2-[acp][c] + 1 NADP+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_13083
- Source: orthology-esiliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus