Difference between revisions of "S-ubiquitinyl-UAP-E1-L-cysteine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-OCTAPRENYL-6-METHOXYPHENOL 2-OCTAPRENYL-6-METHOXYPHENOL] == * smiles: ** CC(=CCCC(=CCCC(=CCCC...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ubiquitinyl-UAP-E1-L-cysteine S-ubiquitinyl-UAP-E1-L-cysteine] == * common name: ** an S-ubiq...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-OCTAPRENYL-6-METHOXYPHENOL 2-OCTAPRENYL-6-METHOXYPHENOL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ubiquitinyl-UAP-E1-L-cysteine S-ubiquitinyl-UAP-E1-L-cysteine] ==
* smiles:
+
** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(O)=C(OC)C=CC=1))C)C)C)C)C)C)C)C
+
* inchi key:
+
** InChIKey=MARGKPIMNMASKJ-CMAXTTDKSA-N
+
 
* common name:
 
* common name:
** 2-methoxy-6-(all-trans-octaprenyl)phenol
+
** an S-ubiquitinyl-[E1 ubiquitin-activating enzyme]-L-cysteine
* molecular weight:
+
** 669.085   
+
 
* Synonym(s):
 
* Synonym(s):
** 2-methoxy-6-all-trans-octaprenylphenol
+
** an S-ubiquitinyl-[ubiquitin-activating enzyme E1]-L-cysteine
** 2-octaprenyl-6-methoxyphenol
+
** an S-ubiquitinyl-[ubiquitin-activating E1 enzyme]-L-cysteine
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-15563]]
 +
* [[RXN-15556]]
 +
* [[RXN-16314]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2-OCTAPRENYL-6-OHPHENOL-METHY-RXN]]
+
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an S-ubiquitinyl-[E1 ubiquitin-activating enzyme]-L-cysteine}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280834 5280834]
+
{{#set: common name=an S-ubiquitinyl-[ubiquitin-activating enzyme E1]-L-cysteine|an S-ubiquitinyl-[ubiquitin-activating E1 enzyme]-L-cysteine}}
* CHEMSPIDER:
+
{{#set: consumed by=RXN-15563|RXN-15556|RXN-16314}}
** [http://www.chemspider.com/Chemical-Structure.4444383.html 4444383]
+
{{#set: produced by=UBIQUITIN--PROTEIN-LIGASE-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1235 1235]
+
* BIGG : 2omph
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C05812 C05812]
+
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(O)=C(OC)C=CC=1))C)C)C)C)C)C)C)C}}
+
{{#set: inchi key=InChIKey=MARGKPIMNMASKJ-CMAXTTDKSA-N}}
+
{{#set: common name=2-methoxy-6-(all-trans-octaprenyl)phenol}}
+
{{#set: molecular weight=669.085    }}
+
{{#set: common name=2-methoxy-6-all-trans-octaprenylphenol|2-octaprenyl-6-methoxyphenol}}
+
{{#set: produced by=2-OCTAPRENYL-6-OHPHENOL-METHY-RXN}}
+

Latest revision as of 20:05, 21 March 2018

Metabolite S-ubiquitinyl-UAP-E1-L-cysteine

  • common name:
    • an S-ubiquitinyl-[E1 ubiquitin-activating enzyme]-L-cysteine
  • Synonym(s):
    • an S-ubiquitinyl-[ubiquitin-activating enzyme E1]-L-cysteine
    • an S-ubiquitinyl-[ubiquitin-activating E1 enzyme]-L-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an S-ubiquitinyl-[E1 ubiquitin-activating enzyme]-L-cysteine" cannot be used as a page name in this wiki.
  • "an S-ubiquitinyl-[ubiquitin-activating enzyme E1]-L-cysteine" cannot be used as a page name in this wiki.
  • "an S-ubiquitinyl-[ubiquitin-activating E1 enzyme]-L-cysteine" cannot be used as a page name in this wiki.