Difference between revisions of "CPD-13910"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HOLO-ACP-SYNTH-RXN HOLO-ACP-SYNTH-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** 4_-phosph...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13910 CPD-13910] == * smiles: ** C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1) * common name: ** cyclic...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=HOLO-ACP-SYNTH-RXN HOLO-ACP-SYNTH-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13910 CPD-13910] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1)
 
* common name:
 
* common name:
−
** 4_-phosphopantetheinyl_transferase
+
** cyclic- 3,4-O-oxalyl-L-threonate
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.7.8.7 EC-2.7.8.7]
+
** InChIKey=FTDFTFXOJYXVTH-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 189.101   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3,4-cyclic oxalyl theronolactone
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CO-A]][c] '''+''' 1 [[apo-ACP]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[ACP]][c] '''+''' 1 [[3-5-ADP]][c]
+
* [[RXN-12872]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 coenzyme A[c] '''+''' 1 an apo-[acyl-carrier protein][c] '''=>''' 1 H+[c] '''+''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 adenosine 3',5'-bisphosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_14278]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_12201]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-6012-1]], acyl carrier protein activation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6012-1 PWY-6012-1]
+
−
** '''1''' reactions found over '''1''' reactions in the full pathway
+
−
* [[PWY-6012]], acyl carrier protein metabolism: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6012 PWY-6012]
+
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R01625 R01625]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658084 90658084]
−
* UNIPROT:
+
{{#set: smiles=C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1)}}
−
** [http://www.uniprot.org/uniprot/Q9PMP8 Q9PMP8]
+
{{#set: common name=cyclic- 3,4-O-oxalyl-L-threonate}}
−
** [http://www.uniprot.org/uniprot/P24224 P24224]
+
{{#set: inchi key=InChIKey=FTDFTFXOJYXVTH-UHFFFAOYSA-M}}
−
** [http://www.uniprot.org/uniprot/O84102 O84102]
+
{{#set: molecular weight=189.101    }}
−
** [http://www.uniprot.org/uniprot/Q9RQW2 Q9RQW2]
+
{{#set: common name=3,4-cyclic oxalyl theronolactone}}
−
** [http://www.uniprot.org/uniprot/O83800 O83800]
+
{{#set: produced by=RXN-12872}}
−
** [http://www.uniprot.org/uniprot/Q9ZCX5 Q9ZCX5]
+
−
** [http://www.uniprot.org/uniprot/Q9ZL36 Q9ZL36]
+
−
** [http://www.uniprot.org/uniprot/O25488 O25488]
+
−
** [http://www.uniprot.org/uniprot/P96618 P96618]
+
−
** [http://www.uniprot.org/uniprot/O66995 O66995]
+
−
** [http://www.uniprot.org/uniprot/P0A4W8 P0A4W8]
+
−
{{#set: direction=LEFT-TO-RIGHT}}
+
−
{{#set: common name=4_-phosphopantetheinyl_transferase}}
+
−
{{#set: ec number=EC-2.7.8.7}}
+
−
{{#set: gene associated=Tiso_gene_14278|Tiso_gene_12201}}
+
−
{{#set: in pathway=PWY-6012-1|PWY-6012}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=esiliculosus}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=in-silico_annotation}}
+

Latest revision as of 21:05, 21 March 2018

Metabolite CPD-13910

  • smiles:
    • C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1)
  • common name:
    • cyclic- 3,4-O-oxalyl-L-threonate
  • inchi key:
    • InChIKey=FTDFTFXOJYXVTH-UHFFFAOYSA-M
  • molecular weight:
    • 189.101
  • Synonym(s):
    • 3,4-cyclic oxalyl theronolactone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-13910&oldid=45834"