Difference between revisions of "Tiso gene 8756"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13910 CPD-13910] == * smiles: ** C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1) * inchi key: ** InChIKey...")
 
(Created page with "Category:Gene == Gene Tiso_gene_8756 == * Synonym(s): == Reactions associated == * Reaction: AMACETOXID-RXN ** Source: orthology-athaliana ** Source: orthology-...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13910 CPD-13910] ==
+
== Gene Tiso_gene_8756 ==
−
* smiles:
+
−
** C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1)
+
−
* inchi key:
+
−
** InChIKey=FTDFTFXOJYXVTH-UHFFFAOYSA-M
+
−
* common name:
+
−
** cyclic- 3,4-O-oxalyl-L-threonate
+
−
* molecular weight:
+
−
** 189.101   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3,4-cyclic oxalyl theronolactone
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[AMACETOXID-RXN]]
−
* [[RXN-12872]]
+
** Source: [[orthology-athaliana]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[AMINEOXID-RXN]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[AMINEPHEN-RXN]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-11784]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-5821]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-6381]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-9597]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-9600]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[RXN6666-4]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-7431]]
 +
* [[PWY-3981]]
 +
* [[THRDLCTCAT-PWY]]
 +
* [[PWY6666-2]]
 +
* [[2PHENDEG-PWY]]
 +
* [[PWY-6181]]
 +
* [[PWY-6802]]
 +
* [[PWY-5751]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: reaction associated=AMACETOXID-RXN|AMINEOXID-RXN|AMINEPHEN-RXN|RXN-11784|RXN-5821|RXN-6381|RXN-9597|RXN-9600|RXN6666-4}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658084 90658084]
+
{{#set: pathway associated=PWY-7431|PWY-3981|THRDLCTCAT-PWY|PWY6666-2|2PHENDEG-PWY|PWY-6181|PWY-6802|PWY-5751}}
−
{{#set: smiles=C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1)}}
+
−
{{#set: inchi key=InChIKey=FTDFTFXOJYXVTH-UHFFFAOYSA-M}}
+
−
{{#set: common name=cyclic- 3,4-O-oxalyl-L-threonate}}
+
−
{{#set: molecular weight=189.101    }}
+
−
{{#set: common name=3,4-cyclic oxalyl theronolactone}}
+
−
{{#set: produced by=RXN-12872}}
+

Latest revision as of 20:05, 21 March 2018

Gene Tiso_gene_8756

  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_8756&oldid=45837"