Difference between revisions of "Tiso gene 8756"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13910 CPD-13910] == * smiles: ** C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1) * inchi key: ** InChIKey...") |
(Created page with "Category:Gene == Gene Tiso_gene_8756 == * Synonym(s): == Reactions associated == * Reaction: AMACETOXID-RXN ** Source: orthology-athaliana ** Source: orthology-...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_8756 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[AMACETOXID-RXN]] | |
− | * [[RXN- | + | ** Source: [[orthology-athaliana]] |
− | == | + | ** Source: [[orthology-esiliculosus]] |
+ | * Reaction: [[AMINEOXID-RXN]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[AMINEPHEN-RXN]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-11784]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-5821]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-6381]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-9597]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-9600]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[RXN6666-4]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7431]] | ||
+ | * [[PWY-3981]] | ||
+ | * [[THRDLCTCAT-PWY]] | ||
+ | * [[PWY6666-2]] | ||
+ | * [[2PHENDEG-PWY]] | ||
+ | * [[PWY-6181]] | ||
+ | * [[PWY-6802]] | ||
+ | * [[PWY-5751]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=AMACETOXID-RXN|AMINEOXID-RXN|AMINEPHEN-RXN|RXN-11784|RXN-5821|RXN-6381|RXN-9597|RXN-9600|RXN6666-4}} | |
− | + | {{#set: pathway associated=PWY-7431|PWY-3981|THRDLCTCAT-PWY|PWY6666-2|2PHENDEG-PWY|PWY-6181|PWY-6802|PWY-5751}} | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 21:05, 21 March 2018
Gene Tiso_gene_8756
- Synonym(s):
Reactions associated
- Reaction: AMACETOXID-RXN
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Reaction: AMINEOXID-RXN
- Source: orthology-esiliculosus
- Reaction: AMINEPHEN-RXN
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Reaction: RXN-11784
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Reaction: RXN-5821
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Reaction: RXN-6381
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Reaction: RXN-9597
- Source: orthology-esiliculosus
- Reaction: RXN-9600
- Source: orthology-creinhardtii
- Reaction: RXN6666-4
- Source: orthology-athaliana
- Source: orthology-esiliculosus