Difference between revisions of "Tiso gene 13303"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1130 CPD-1130] == * smiles: ** CCC(C([O-])=O)C(C(=O)[O-])O * common name: ** 3-ethylmalate...") |
(Created page with "Category:Gene == Gene Tiso_gene_13303 == * right end position: ** 6215 * transcription direction: ** POSITIVE * left end position: ** 3623 * centisome position: ** 56.7157...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_13303 == |
− | * | + | * right end position: |
− | ** | + | ** 6215 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 3623 |
− | * | + | * centisome position: |
− | ** | + | ** 56.715714 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[DNA-DIRECTED-DNA-POLYMERASE-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | + | *** Assignment: ec-number | |
− | * [[ | + | ** Source: [[annotation-experimental_annotation]] |
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=6215}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=3623}} | |
− | + | {{#set: centisome position=56.715714 }} | |
− | + | {{#set: reaction associated=DNA-DIRECTED-DNA-POLYMERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:05, 21 March 2018
Gene Tiso_gene_13303
- right end position:
- 6215
- transcription direction:
- POSITIVE
- left end position:
- 3623
- centisome position:
- 56.715714
- Synonym(s):
Reactions associated
- Reaction: DNA-DIRECTED-DNA-POLYMERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation