Difference between revisions of "INDOLE-3-GLYCOL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCOL INDOLE-3-GLYCOL] == * smiles: ** C2(=C(C1(C=CC=CC=1N2))C(O)CO) * inchi key: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCOL INDOLE-3-GLYCOL] == * smiles: ** C2(=C(C1(C=CC=CC=1N2))C(O)CO) * common name: *...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C2(=C(C1(C=CC=CC=1N2))C(O)CO) | ** C2(=C(C1(C=CC=CC=1N2))C(O)CO) | ||
− | |||
− | |||
* common name: | * common name: | ||
** indole-3-glycol | ** indole-3-glycol | ||
+ | * inchi key: | ||
+ | ** InChIKey=XNJDZRGYWQBBMZ-UHFFFAOYSA-N | ||
* molecular weight: | * molecular weight: | ||
** 177.202 | ** 177.202 | ||
Line 19: | Line 19: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202910 25202910] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202910 25202910] | ||
{{#set: smiles=C2(=C(C1(C=CC=CC=1N2))C(O)CO)}} | {{#set: smiles=C2(=C(C1(C=CC=CC=1N2))C(O)CO)}} | ||
− | |||
{{#set: common name=indole-3-glycol}} | {{#set: common name=indole-3-glycol}} | ||
+ | {{#set: inchi key=InChIKey=XNJDZRGYWQBBMZ-UHFFFAOYSA-N}} | ||
{{#set: molecular weight=177.202 }} | {{#set: molecular weight=177.202 }} | ||
{{#set: produced by=RXN-5424}} | {{#set: produced by=RXN-5424}} |
Latest revision as of 21:05, 21 March 2018
Contents
Metabolite INDOLE-3-GLYCOL
- smiles:
- C2(=C(C1(C=CC=CC=1N2))C(O)CO)
- common name:
- indole-3-glycol
- inchi key:
- InChIKey=XNJDZRGYWQBBMZ-UHFFFAOYSA-N
- molecular weight:
- 177.202
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM: