Difference between revisions of "Tiso gene 2932"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15691 CPD-15691] == * smiles: ** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
(Created page with "Category:Gene == Gene Tiso_gene_2932 == * right end position: ** 17043 * transcription direction: ** NEGATIVE * left end position: ** 16049 * centisome position: ** 89.324...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15691 CPD-15691] ==
+
== Gene Tiso_gene_2932 ==
−
* smiles:
+
* right end position:
−
** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 17043
−
* inchi key:
+
* transcription direction:
−
** InChIKey=VKLHSLOWDWGVGP-WOABMHMMSA-J
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** 5-trans-3-oxo-dodecenoyl-CoA
+
** 16049
−
* molecular weight:
+
* centisome position:
−
** 957.775    
+
** 89.324875    
 
* Synonym(s):
 
* Synonym(s):
−
** 5E-3-oxo-dodecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-14803]]
+
* Reaction: [[RXN-15556]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-experimental_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-7511]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=17043}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658857 90658857]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=16049}}
−
{{#set: inchi key=InChIKey=VKLHSLOWDWGVGP-WOABMHMMSA-J}}
+
{{#set: centisome position=89.324875   }}
−
{{#set: common name=5-trans-3-oxo-dodecenoyl-CoA}}
+
{{#set: reaction associated=RXN-15556}}
−
{{#set: molecular weight=957.775   }}
+
{{#set: pathway associated=PWY-7511}}
−
{{#set: common name=5E-3-oxo-dodecenoyl-CoA}}
+
−
{{#set: consumed by=RXN-14803}}
+

Latest revision as of 20:05, 21 March 2018

Gene Tiso_gene_2932

  • right end position:
    • 17043
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 16049
  • centisome position:
    • 89.324875
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_2932&oldid=45867"