Difference between revisions of "Tiso gene 18647"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARATE COUMARATE] == * smiles: ** C(=O)([O-])C=CC1(=CC=C(O)C=C1) * inchi key: ** InChIKey=NG...") |
(Created page with "Category:Gene == Gene Tiso_gene_18647 == * right end position: ** 2867 * transcription direction: ** POSITIVE * left end position: ** 1421 * centisome position: ** 25.4522...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_18647 == |
− | * | + | * right end position: |
− | ** | + | ** 2867 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 1421 |
− | * | + | * centisome position: |
− | ** | + | ** 25.452265 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[OROPRIBTRANS-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | == | + | ** Source: [[orthology-athaliana]] |
+ | ** Source: [[orthology-synechocystis]] | ||
+ | * Reaction: [[OROTPDECARB-RXN]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[orPDC]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[orPRT]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7790]] | ||
+ | * [[PWY-7791]] | ||
+ | * [[PWY-5686]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=2867}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=1421}} | |
− | + | {{#set: centisome position=25.452265 }} | |
− | + | {{#set: reaction associated=OROPRIBTRANS-RXN|OROTPDECARB-RXN|orPDC|orPRT}} | |
− | + | {{#set: pathway associated=PWY-7790|PWY-7791|PWY-5686}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 21:05, 21 March 2018
Gene Tiso_gene_18647
- right end position:
- 2867
- transcription direction:
- POSITIVE
- left end position:
- 1421
- centisome position:
- 25.452265
- Synonym(s):
Reactions associated
- Reaction: OROPRIBTRANS-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: annotation-in-silico_annotation
- Reaction: OROTPDECARB-RXN
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Reaction: orPDC
- Source: orthology-creinhardtii
- Reaction: orPRT
- Source: orthology-creinhardtii