Difference between revisions of "Beta-D-Galactosides"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13910 CPD-13910] == * smiles: ** C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1) * inchi key: ** InChIKey...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-D-Galactosides Beta-D-Galactosides] == * common name: ** a β-D-galactoside * Synonym(...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-D-Galactosides Beta-D-Galactosides] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a β-D-galactoside |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a β-D-galactoside |
| + | ** β-D-galactoside | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[3.2.1.23-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a β-D-galactoside}} | |
| − | + | {{#set: common name=a β-D-galactoside|β-D-galactoside}} | |
| − | {{#set: | + | {{#set: consumed by=3.2.1.23-RXN}} |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Latest revision as of 21:05, 21 March 2018
Contents
Metabolite Beta-D-Galactosides
- common name:
- a β-D-galactoside
- Synonym(s):
- a β-D-galactoside
- β-D-galactoside
