Difference between revisions of "CPD-226"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=COBALADENOSYLTRANS-RXN COBALADENOSYLTRANS-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** c...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-226 CPD-226] == * smiles: ** C=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-226 CPD-226] == |
− | * | + | * smiles: |
− | ** | + | ** C=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O |
* common name: | * common name: | ||
− | ** | + | ** vinylacetyl-CoA |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=UATIGEHITDTAGF-CITAKDKDSA-J |
+ | * molecular weight: | ||
+ | ** 831.577 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-butenoyl-CoA | ||
+ | ** but-3-enoyl-CoA | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[VINYLACETYL-COA-DELTA-ISOMERASE-RXN]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266616 45266616] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57396 57396] |
− | * | + | * LIGAND-CPD: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02331 C02331] |
− | + | {{#set: smiles=C=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} | |
− | {{#set: | + | {{#set: common name=vinylacetyl-CoA}} |
− | + | {{#set: inchi key=InChIKey=UATIGEHITDTAGF-CITAKDKDSA-J}} | |
− | + | {{#set: molecular weight=831.577 }} | |
− | + | {{#set: common name=3-butenoyl-CoA|but-3-enoyl-CoA}} | |
− | {{#set: | + | {{#set: reversible reaction associated=VINYLACETYL-COA-DELTA-ISOMERASE-RXN}} |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 21:06, 21 March 2018
Contents
Metabolite CPD-226
- smiles:
- C=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
- common name:
- vinylacetyl-CoA
- inchi key:
- InChIKey=UATIGEHITDTAGF-CITAKDKDSA-J
- molecular weight:
- 831.577
- Synonym(s):
- 3-butenoyl-CoA
- but-3-enoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.