Difference between revisions of "CPD-7422"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Alkyl-Hydro-Peroxides Alkyl-Hydro-Peroxides] == * common name: ** an organic hydroperoxide * Sy...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7422 CPD-7422] == * smiles: ** CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC=C1C)(C)C))...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7422 CPD-7422] == |
| + | * smiles: | ||
| + | ** CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC=C1C)(C)C))C)C)C)C)C)C | ||
* common name: | * common name: | ||
| − | ** | + | ** α-zeacarotene |
| + | * inchi key: | ||
| + | ** InChIKey=IGABZIVJSNQMPZ-DWQNOKSTSA-N | ||
| + | * molecular weight: | ||
| + | ** 538.898 | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[RXN-8040]] |
== External links == | == External links == | ||
| − | {{#set: | + | * LIPID_MAPS : LMPR01070285 |
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6441660 6441660] |
| − | {{#set: | + | * HMDB : HMDB36909 |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C14146 C14146] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.4945802.html 4945802] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35063 35063] | ||
| + | {{#set: smiles=CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC=C1C)(C)C))C)C)C)C)C)C}} | ||
| + | {{#set: common name=α-zeacarotene}} | ||
| + | {{#set: inchi key=InChIKey=IGABZIVJSNQMPZ-DWQNOKSTSA-N}} | ||
| + | {{#set: molecular weight=538.898 }} | ||
| + | {{#set: reversible reaction associated=RXN-8040}} | ||
Latest revision as of 20:06, 21 March 2018
Contents
Metabolite CPD-7422
- smiles:
- CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC=C1C)(C)C))C)C)C)C)C)C
- common name:
- α-zeacarotene
- inchi key:
- InChIKey=IGABZIVJSNQMPZ-DWQNOKSTSA-N
- molecular weight:
- 538.898
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- LIPID_MAPS : LMPR01070285
- PUBCHEM:
- HMDB : HMDB36909
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
