Difference between revisions of "2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_7584 == * left end position: ** 1159 * transcription direction: ** NEGATIVE * right end position: ** 5610 * centisome position: ** 10.54499...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET] == * smiles:...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_7584 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET] ==
* left end position:
+
* smiles:
** 1159
+
** CC(OP([O-])([O-])=O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(C(O)C(N1(C(N=C(C=C1)N)=O))O2)O))([O-])=O
* transcription direction:
+
* common name:
** NEGATIVE
+
** 2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol
* right end position:
+
* inchi key:
** 5610
+
** InChIKey=HTJXTKBIUVFUAR-XHIBXCGHSA-J
* centisome position:
+
* molecular weight:
** 10.5449915    
+
** 597.259    
 
* Synonym(s):
 
* Synonym(s):
 +
** CDP-ME-2P
 +
** CDP-methyl-D-erylthritol 2-phosphate
 +
** 4-diphosphocytidyl-2C-methyl-D-erythritol 2-phosphate
 +
** 4-diphosphocytidyl-2-C-methylerythritol 2-phosphate
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]]
+
* [[RXN0-302]]
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
***ec-number
+
* [[2.7.1.148-RXN]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: left end position=1159}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878430 46878430]
{{#set: right end position=5610}}
+
* CHEBI:
{{#set: centisome position=10.5449915   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57919 57919]
{{#set: reaction associated=TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN}}
+
* BIGG : 2p4c2me
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C11436 C11436]
 +
{{#set: smiles=CC(OP([O-])([O-])=O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(C(O)C(N1(C(N=C(C=C1)N)=O))O2)O))([O-])=O}}
 +
{{#set: common name=2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol}}
 +
{{#set: inchi key=InChIKey=HTJXTKBIUVFUAR-XHIBXCGHSA-J}}
 +
{{#set: molecular weight=597.259   }}
 +
{{#set: common name=CDP-ME-2P|CDP-methyl-D-erylthritol 2-phosphate|4-diphosphocytidyl-2C-methyl-D-erythritol 2-phosphate|4-diphosphocytidyl-2-C-methylerythritol 2-phosphate}}
 +
{{#set: consumed by=RXN0-302}}
 +
{{#set: produced by=2.7.1.148-RXN}}

Latest revision as of 21:06, 21 March 2018

Metabolite 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET

  • smiles:
    • CC(OP([O-])([O-])=O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(C(O)C(N1(C(N=C(C=C1)N)=O))O2)O))([O-])=O
  • common name:
    • 2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol
  • inchi key:
    • InChIKey=HTJXTKBIUVFUAR-XHIBXCGHSA-J
  • molecular weight:
    • 597.259
  • Synonym(s):
    • CDP-ME-2P
    • CDP-methyl-D-erylthritol 2-phosphate
    • 4-diphosphocytidyl-2C-methyl-D-erythritol 2-phosphate
    • 4-diphosphocytidyl-2-C-methylerythritol 2-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(OP([O-])([O-])=O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(C(O)C(N1(C(N=C(C=C1)N)=O))O2)O))([O-])=O" cannot be used as a page name in this wiki.