Difference between revisions of "CPD-7682"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_2449 == * left end position: ** 6879 * transcription direction: ** POSITIVE * right end position: ** 7497 * centisome position: ** 35.44962...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7682 CPD-7682] == * smiles: ** C(C1(CCCC=N1))([O-])=O * common name: ** (S)-2,3,4,5-tetrahy...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7682 CPD-7682] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(C1(CCCC=N1))([O-])=O |
| − | * | + | * common name: |
| − | ** | + | ** (S)-2,3,4,5-tetrahydropiperidine-2-carboxylate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=CSDPVAKVEWETFG-YFKPBYRVSA-M |
| − | * | + | * molecular weight: |
| − | ** | + | ** 126.135 |
* Synonym(s): | * Synonym(s): | ||
| + | ** Δ1-piperideine-6-carboxylate | ||
| + | ** Δ6-piperideine-2-carboxylate | ||
| + | ** 1,6-didehydropiperidine-2-carboxylate | ||
| + | ** 2,3,4,5-tetrahydropyridine-2-carboxylate | ||
| + | ** 1-piperideine 6-carboxylate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-8162]] |
| − | + | * [[RXN-10855]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-8173]] | |
| − | + | ||
| − | * [[RXN- | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00450 C00450] |
| − | {{#set: | + | * HMDB : HMDB59657 |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58769 58769] |
| − | {{#set: | + | * METABOLIGHTS : MTBLC58769 |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266761 45266761] | ||
| + | {{#set: smiles=C(C1(CCCC=N1))([O-])=O}} | ||
| + | {{#set: common name=(S)-2,3,4,5-tetrahydropiperidine-2-carboxylate}} | ||
| + | {{#set: inchi key=InChIKey=CSDPVAKVEWETFG-YFKPBYRVSA-M}} | ||
| + | {{#set: molecular weight=126.135 }} | ||
| + | {{#set: common name=Δ1-piperideine-6-carboxylate|Δ6-piperideine-2-carboxylate|1,6-didehydropiperidine-2-carboxylate|2,3,4,5-tetrahydropyridine-2-carboxylate|1-piperideine 6-carboxylate}} | ||
| + | {{#set: consumed by=RXN-8162|RXN-10855}} | ||
| + | {{#set: reversible reaction associated=RXN-8173}} | ||
Latest revision as of 20:06, 21 March 2018
Contents
Metabolite CPD-7682
- smiles:
- C(C1(CCCC=N1))([O-])=O
- common name:
- (S)-2,3,4,5-tetrahydropiperidine-2-carboxylate
- inchi key:
- InChIKey=CSDPVAKVEWETFG-YFKPBYRVSA-M
- molecular weight:
- 126.135
- Synonym(s):
- Δ1-piperideine-6-carboxylate
- Δ6-piperideine-2-carboxylate
- 1,6-didehydropiperidine-2-carboxylate
- 2,3,4,5-tetrahydropyridine-2-carboxylate
- 1-piperideine 6-carboxylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C1(CCCC=N1))([O-])=O" cannot be used as a page name in this wiki.
