Difference between revisions of "Tiso gene 12953"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCOL INDOLE-3-GLYCOL] == * smiles: ** C2(=C(C1(C=CC=CC=1N2))C(O)CO) * common name: *...") |
(Created page with "Category:Gene == Gene Tiso_gene_12953 == * right end position: ** 2520 * transcription direction: ** POSITIVE * left end position: ** 9 * centisome position: ** 0.13632233...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_12953 == |
| − | * | + | * right end position: |
| − | ** | + | ** 2520 |
| − | * | + | * transcription direction: |
| − | ** | + | ** POSITIVE |
| − | * | + | * left end position: |
| − | ** | + | ** 9 |
| − | * | + | * centisome position: |
| − | ** | + | ** 0.13632233 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reactions associated == |
| − | + | * Reaction: [[ATPASE-RXN]] | |
| − | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
| − | == | + | *** Assignment: automated-name-match |
| + | == Pathways associated == | ||
== External links == | == External links == | ||
| − | + | {{#set: right end position=2520}} | |
| − | + | {{#set: transcription direction=POSITIVE}} | |
| − | {{#set: | + | {{#set: left end position=9}} |
| − | {{#set: | + | {{#set: centisome position=0.13632233 }} |
| − | {{#set: | + | {{#set: reaction associated=ATPASE-RXN}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 21:06, 21 March 2018
Gene Tiso_gene_12953
- right end position:
- 2520
- transcription direction:
- POSITIVE
- left end position:
- 9
- centisome position:
- 0.13632233
- Synonym(s):
Reactions associated
- Reaction: ATPASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
