Difference between revisions of "GDP-TP"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_18257 == * Synonym(s): == Reactions associated == * RXN-1104 ** pantograph-esiliculosus * RXN-1143 ** pantograph-esi...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-TP GDP-TP] == * smiles: ** C(OP([O-])(=O)OP([O-])(=O)OP([O-])(=O)[O-])C1(OC(C(O)C(OP([O-])(...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-TP GDP-TP] == |
+ | * smiles: | ||
+ | ** C(OP([O-])(=O)OP([O-])(=O)OP([O-])(=O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP(O)([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) | ||
+ | * common name: | ||
+ | ** pppGpp | ||
+ | * inchi key: | ||
+ | ** InChIKey=KCPMACXZAITQAX-UUOKFMHZSA-H | ||
+ | * molecular weight: | ||
+ | ** 677.095 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** guanosine pentaphosphate | ||
+ | ** guanosine 3'-diphosphate 5'-triphosphate | ||
+ | ** guanosine 5'-triphosphate,3'-diphosphate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN0-6427]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * [[ | + | * [[GTPPYPHOSKIN-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04494 C04494] |
+ | * HMDB : HMDB60480 | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16690 16690] | ||
+ | * BIGG : gdptp | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173549 46173549] | ||
+ | {{#set: smiles=C(OP([O-])(=O)OP([O-])(=O)OP([O-])(=O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP(O)([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}} | ||
+ | {{#set: common name=pppGpp}} | ||
+ | {{#set: inchi key=InChIKey=KCPMACXZAITQAX-UUOKFMHZSA-H}} | ||
+ | {{#set: molecular weight=677.095 }} | ||
+ | {{#set: common name=guanosine pentaphosphate|guanosine 3'-diphosphate 5'-triphosphate|guanosine 5'-triphosphate,3'-diphosphate}} | ||
+ | {{#set: consumed by=RXN0-6427}} | ||
+ | {{#set: produced by=GTPPYPHOSKIN-RXN}} |
Latest revision as of 21:06, 21 March 2018
Contents
Metabolite GDP-TP
- smiles:
- C(OP([O-])(=O)OP([O-])(=O)OP([O-])(=O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP(O)([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
- common name:
- pppGpp
- inchi key:
- InChIKey=KCPMACXZAITQAX-UUOKFMHZSA-H
- molecular weight:
- 677.095
- Synonym(s):
- guanosine pentaphosphate
- guanosine 3'-diphosphate 5'-triphosphate
- guanosine 5'-triphosphate,3'-diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP([O-])(=O)OP([O-])(=O)OP([O-])(=O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP(O)([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.