Difference between revisions of "THYMINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15675 CPD-15675] == * smiles: ** CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THYMINE THYMINE] == * smiles: ** CC1(C(=O)NC(NC=1)=O) * common name: ** thymine * inchi key: **...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THYMINE THYMINE] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC1(C(=O)NC(NC=1)=O) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** thymine |
+ | * inchi key: | ||
+ | ** InChIKey=RWQNBRDOKXIBIV-UHFFFAOYSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 126.115 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 5-methyluracil |
+ | ** 5-methyl-2,4(1H,3H)-pyrimidinedione | ||
+ | ** T | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[THYM-PHOSPH-RXN]] | ||
== External links == | == External links == | ||
+ | * CAS : 65-71-4 | ||
+ | * BIGG : thym | ||
+ | * DRUGBANK : DB03462 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1135 1135] |
− | {{#set: smiles= | + | * HMDB : HMDB00262 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00178 C00178] |
− | {{#set: molecular weight= | + | * CHEMSPIDER: |
− | {{#set: common name= | + | ** [http://www.chemspider.com/Chemical-Structure.1103.html 1103] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17821 17821] | ||
+ | * METABOLIGHTS : MTBLC17821 | ||
+ | {{#set: smiles=CC1(C(=O)NC(NC=1)=O)}} | ||
+ | {{#set: common name=thymine}} | ||
+ | {{#set: inchi key=InChIKey=RWQNBRDOKXIBIV-UHFFFAOYSA-N}} | ||
+ | {{#set: molecular weight=126.115 }} | ||
+ | {{#set: common name=5-methyluracil|5-methyl-2,4(1H,3H)-pyrimidinedione|T}} | ||
+ | {{#set: reversible reaction associated=THYM-PHOSPH-RXN}} |
Latest revision as of 20:06, 21 March 2018
Contents
Metabolite THYMINE
- smiles:
- CC1(C(=O)NC(NC=1)=O)
- common name:
- thymine
- inchi key:
- InChIKey=RWQNBRDOKXIBIV-UHFFFAOYSA-N
- molecular weight:
- 126.115
- Synonym(s):
- 5-methyluracil
- 5-methyl-2,4(1H,3H)-pyrimidinedione
- T
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 65-71-4
- BIGG : thym
- DRUGBANK : DB03462
- PUBCHEM:
- HMDB : HMDB00262
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC17821