Difference between revisions of "CPD-11671"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATDUD ATDUD] == * direction: ** LEFT-TO-RIGHT * common name: ** ATP:dUDP phosphotransferase * Synon...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11671 CPD-11671] == * smiles: ** C(O)CC1(=CNC2(=C1C=C(O)C=C2)) * common name: ** 5-hydroxyt...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATDUD ATDUD] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11671 CPD-11671] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(O)CC1(=CNC2(=C1C=C(O)C=C2))
 
* common name:
 
* common name:
−
** ATP:dUDP phosphotransferase
+
** 5-hydroxytryptophol
 +
* inchi key:
 +
** InChIKey=KQROHCSYOGBQGJ-UHFFFAOYSA-N
 +
* molecular weight:
 +
** 177.202   
 
* Synonym(s):
 
* Synonym(s):
 +
** hydroxytryptophol
 +
** 5-hydroxyindole-3-ethanol
 +
** 5-hydroxy-1H-indole-3-ethanol
 +
** 1H-indole-3-ethanol, 5-hydroxy-
 +
** indole-3-ethanol, 5-hydroxy-
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-10784]]
−
** 1.0 [[ATP]][c] '''+''' 1.0 [[DUDP]][c] '''=>''' 1.0 [[DUTP]][c] '''+''' 1.0 [[ADP]][c]
+
* [[RXN-10782]]
−
* With common name(s):
+
== Reaction(s) known to produce the compound ==
−
** 1.0 ATP[c] '''+''' 1.0 dUDP[c] '''=>''' 1.0 dUTP[c] '''+''' 1.0 ADP[c]
+
* [[RXN-10781]]
−
 
+
== Reaction(s) of unknown directionality ==
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_16529]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_13128]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=ATP:dUDP phosphotransferase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9061 9061]
−
{{#set: gene associated=Tiso_gene_16529|Tiso_gene_13128}}
+
* CHEMSPIDER:
−
{{#set: in pathway=}}
+
** [http://www.chemspider.com/Chemical-Structure.8708.html 8708]
−
{{#set: reconstruction category=orthology}}
+
* HMDB : HMDB01855
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: smiles=C(O)CC1(=CNC2(=C1C=C(O)C=C2))}}
−
{{#set: reconstruction source=creinhardtii}}
+
{{#set: common name=5-hydroxytryptophol}}
 +
{{#set: inchi key=InChIKey=KQROHCSYOGBQGJ-UHFFFAOYSA-N}}
 +
{{#set: molecular weight=177.202    }}
 +
{{#set: common name=hydroxytryptophol|5-hydroxyindole-3-ethanol|5-hydroxy-1H-indole-3-ethanol|1H-indole-3-ethanol, 5-hydroxy-|indole-3-ethanol, 5-hydroxy-}}
 +
{{#set: consumed by=RXN-10784|RXN-10782}}
 +
{{#set: produced by=RXN-10781}}

Latest revision as of 20:06, 21 March 2018

Metabolite CPD-11671

  • smiles:
    • C(O)CC1(=CNC2(=C1C=C(O)C=C2))
  • common name:
    • 5-hydroxytryptophol
  • inchi key:
    • InChIKey=KQROHCSYOGBQGJ-UHFFFAOYSA-N
  • molecular weight:
    • 177.202
  • Synonym(s):
    • hydroxytryptophol
    • 5-hydroxyindole-3-ethanol
    • 5-hydroxy-1H-indole-3-ethanol
    • 1H-indole-3-ethanol, 5-hydroxy-
    • indole-3-ethanol, 5-hydroxy-

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • PUBCHEM:
  • CHEMSPIDER:
  • HMDB : HMDB01855




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-11671&oldid=45947"