|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PHENYLALANINE--TRNA-LIGASE-RXN PHENYLALANINE--TRNA-LIGASE-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOYLCOA BENZOYLCOA] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-] |
| * common name: | | * common name: |
− | ** ORF | + | ** benzoyl-CoA |
− | ** phenylalanine_trna_synthtetase | + | * inchi key: |
− | ** alpha_subunit_of_phenylalanyl-trna_synthetase | + | ** InChIKey=VEVJTUNLALKRNO-TYHXJLICSA-J |
− | ** ribosome_biogenesis_protein | + | * molecular weight: |
− | * ec number:
| + | ** 867.61 |
− | ** [http://enzyme.expasy.org/EC/6.1.1.20 EC-6.1.1.20] | + | |
| * Synonym(s): | | * Synonym(s): |
| + | ** S-benzoate coenzyme A |
| + | ** benzoyl-S-CoA |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
− | ** 1 [[PHE]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[PHE-tRNAs]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[Charged-PHE-tRNAs]][c]
| + | * [[RXN-2006]] |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 L-phenylalanine[c] '''+''' 1 ATP[c] '''+''' 1 a tRNAphe[c] '''=>''' 1 AMP[c] '''+''' 1 diphosphate[c] '''+''' 1 an L-phenylalanyl-[tRNAphe][c]
| + | |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_16467]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_4232]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_16650]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_1625]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | == Pathways == | + | |
− | * [[TRNA-CHARGING-PWY]], tRNA charging: [http://metacyc.org/META/NEW-IMAGE?object=TRNA-CHARGING-PWY TRNA-CHARGING-PWY] | + | |
− | ** '''21''' reactions found over '''21''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * Category: [[orthology]]
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * CAS : 102185-37-5 |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19413 19413]
| + | * PUBCHEM: |
− | * LIGAND-RXN:
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266596 45266596] |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R03660 R03660]
| + | * HMDB : HMDB02252 |
− | * UNIPROT: | + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/P94283 P94283] | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57369 57369] |
− | ** [http://www.uniprot.org/uniprot/Q9ZDB4 Q9ZDB4]
| + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/Q9WZS9 Q9WZS9]
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00512 C00512] |
− | ** [http://www.uniprot.org/uniprot/Q9PP34 Q9PP34] | + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}} |
− | ** [http://www.uniprot.org/uniprot/P56145 P56145] | + | {{#set: common name=benzoyl-CoA}} |
− | ** [http://www.uniprot.org/uniprot/O67620 O67620] | + | {{#set: inchi key=InChIKey=VEVJTUNLALKRNO-TYHXJLICSA-J}} |
− | ** [http://www.uniprot.org/uniprot/O73984 O73984]
| + | {{#set: molecular weight=867.61 }} |
− | ** [http://www.uniprot.org/uniprot/Q9Z6R6 Q9Z6R6]
| + | {{#set: common name=S-benzoate coenzyme A|benzoyl-S-CoA}} |
− | ** [http://www.uniprot.org/uniprot/Q58508 Q58508] | + | {{#set: produced by=RXN-2006}} |
− | ** [http://www.uniprot.org/uniprot/P56146 P56146] | + | |
− | ** [http://www.uniprot.org/uniprot/O27545 O27545]
| + | |
− | ** [http://www.uniprot.org/uniprot/O26837 O26837]
| + | |
− | ** [http://www.uniprot.org/uniprot/O58391 O58391]
| + | |
− | ** [http://www.uniprot.org/uniprot/O83938 O83938]
| + | |
− | ** [http://www.uniprot.org/uniprot/P47436 P47436]
| + | |
− | ** [http://www.uniprot.org/uniprot/O67087 O67087]
| + | |
− | ** [http://www.uniprot.org/uniprot/O83059 O83059]
| + | |
− | ** [http://www.uniprot.org/uniprot/O84843 O84843]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9UYX3 Q9UYX3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Z7W0 Q9Z7W0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PJR8 Q9PJR8]
| + | |
− | ** [http://www.uniprot.org/uniprot/P47437 P47437]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZKF9 Q9ZKF9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9UYX2 Q9UYX2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZKF8 Q9ZKF8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JR76 Q9JR76]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q57911 Q57911]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43819 P43819]
| + | |
− | ** [http://www.uniprot.org/uniprot/P94282 P94282]
| + | |
− | ** [http://www.uniprot.org/uniprot/O84481 O84481]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZDB5 Q9ZDB5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WZS8 Q9WZS8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9RRX8 Q9RRX8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PP35 Q9PP35]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43820 P43820]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q46107 Q46107]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15434 P15434]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q5SGX1 Q5SGX1]
| + | |
− | ** [http://www.uniprot.org/uniprot/P37984 P37984]
| + | |
− | ** [http://www.uniprot.org/uniprot/P51346 P51346]
| + | |
− | ** [http://www.uniprot.org/uniprot/P75563 P75563]
| + | |
− | ** [http://www.uniprot.org/uniprot/P75564 P75564]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q55187 Q55187]
| + | |
− | ** [http://www.uniprot.org/uniprot/P95960 P95960]
| + | |
− | ** [http://www.uniprot.org/uniprot/P95961 P95961]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q49032 Q49032]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08312 P08312]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07395 P07395]
| + | |
− | ** [http://www.uniprot.org/uniprot/O42870 O42870]
| + | |
− | ** [http://www.uniprot.org/uniprot/O13432 O13432]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9GYS8 Q9GYS8]
| + | |
− | ** [http://www.uniprot.org/uniprot/O42849 O42849]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17921 P17921]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17922 P17922]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15625 P15625]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08425 P08425]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15624 P15624]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: common name=ORF}}
| + | |
− | {{#set: common name=phenylalanine_trna_synthtetase}}
| + | |
− | {{#set: common name=alpha_subunit_of_phenylalanyl-trna_synthetase}}
| + | |
− | {{#set: common name=ribosome_biogenesis_protein}} | + | |
− | {{#set: ec number=EC-6.1.1.20}}
| + | |
− | {{#set: gene associated=Tiso_gene_16467|Tiso_gene_4232|Tiso_gene_16650|Tiso_gene_1625}} | + | |
− | {{#set: in pathway=TRNA-CHARGING-PWY}}
| + | |
− | {{#set: reconstruction category=orthology|annotation}} | + | |
− | {{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-esiliculosus}} | + | |
− | {{#set: reconstruction tool=pantograph|pathwaytools}} | + | |