Difference between revisions of "BENZOYLCOA"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_514 == * left end position: ** 23226 * transcription direction: ** POSITIVE * right end position: ** 25085 * centisome position: ** 71.3921...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOYLCOA BENZOYLCOA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(=CC=CC=C1))COP(=O)(OP...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOYLCOA BENZOYLCOA] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-] |
− | * | + | * common name: |
− | ** | + | ** benzoyl-CoA |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=VEVJTUNLALKRNO-TYHXJLICSA-J |
− | * | + | * molecular weight: |
− | ** | + | ** 867.61 |
* Synonym(s): | * Synonym(s): | ||
+ | ** S-benzoate coenzyme A | ||
+ | ** benzoyl-S-CoA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-2006]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 102185-37-5 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266596 45266596] |
− | {{#set: | + | * HMDB : HMDB02252 |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57369 57369] |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00512 C00512] | ||
+ | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}} | ||
+ | {{#set: common name=benzoyl-CoA}} | ||
+ | {{#set: inchi key=InChIKey=VEVJTUNLALKRNO-TYHXJLICSA-J}} | ||
+ | {{#set: molecular weight=867.61 }} | ||
+ | {{#set: common name=S-benzoate coenzyme A|benzoyl-S-CoA}} | ||
+ | {{#set: produced by=RXN-2006}} |
Latest revision as of 20:06, 21 March 2018
Contents
Metabolite BENZOYLCOA
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
- common name:
- benzoyl-CoA
- inchi key:
- InChIKey=VEVJTUNLALKRNO-TYHXJLICSA-J
- molecular weight:
- 867.61
- Synonym(s):
- S-benzoate coenzyme A
- benzoyl-S-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-" cannot be used as a page name in this wiki.