Difference between revisions of "Tiso gene 3487"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19147 CPD-19147] == * smiles: ** CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
(Created page with "Category:Gene == Gene Tiso_gene_3487 == * right end position: ** 16274 * transcription direction: ** POSITIVE * left end position: ** 14515 * centisome position: ** 87.261...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19147 CPD-19147] ==
+
== Gene Tiso_gene_3487 ==
−
* smiles:
+
* right end position:
−
** CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 16274
−
* inchi key:
+
* transcription direction:
−
** InChIKey=JPIHVKICKVPFFY-TWAFKMGKSA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** (7Z)-tetradecenoyl-CoA
+
** 14515
−
* molecular weight:
+
* centisome position:
−
** 971.845    
+
** 87.26103    
 
* Synonym(s):
 
* Synonym(s):
−
** 14:1-Δ7-CoA
 
−
** cis-7-tetradecenoyl-CoA
 
−
** 14:1(n-7)-CoA
 
−
** (7Z)-tetradec-7-enoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17792]]
+
* Reaction: [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-17791]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: right end position=16274}}
−
{{#set: inchi key=InChIKey=JPIHVKICKVPFFY-TWAFKMGKSA-J}}
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: common name=(7Z)-tetradecenoyl-CoA}}
+
{{#set: left end position=14515}}
−
{{#set: molecular weight=971.845   }}
+
{{#set: centisome position=87.26103   }}
−
{{#set: common name=14:1-Δ7-CoA|cis-7-tetradecenoyl-CoA|14:1(n-7)-CoA|(7Z)-tetradec-7-enoyl-CoA}}
+
{{#set: reaction associated=NAD+-ADP-RIBOSYLTRANSFERASE-RXN}}
−
{{#set: consumed by=RXN-17792}}
+
−
{{#set: produced by=RXN-17791}}
+

Latest revision as of 20:06, 21 March 2018

Gene Tiso_gene_3487

  • right end position:
    • 16274
  • transcription direction:
    • POSITIVE
  • left end position:
    • 14515
  • centisome position:
    • 87.26103
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_3487&oldid=45980"