Difference between revisions of "3-INDOLYLGLYCOLALDEHYDE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CHORISMATEMUT-RXN CHORISMATEMUT-RXN] == * direction: ** REVERSIBLE * common name: ** bifunctional_c...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-INDOLYLGLYCOLALDEHYDE 3-INDOLYLGLYCOLALDEHYDE] == * smiles: ** C2(=C(C1(C=CC=CC=1N2))C(O)C=O)...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-INDOLYLGLYCOLALDEHYDE 3-INDOLYLGLYCOLALDEHYDE] == |
− | * | + | * smiles: |
− | ** | + | ** C2(=C(C1(C=CC=CC=1N2))C(O)C=O) |
* common name: | * common name: | ||
− | ** | + | ** indole-3-glycol aldehyde |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=XKZDNWMDLGQXML-UHFFFAOYSA-N |
+ | * molecular weight: | ||
+ | ** 175.187 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-hydroxy-2-(1H-indol-3-yl)acetaldehyde | ||
+ | ** 3-indoleglycol aldehyde | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-5424]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439951 439951] |
− | * | + | * CHEMSPIDER: |
− | ** [http://www. | + | ** [http://www.chemspider.com/Chemical-Structure.388979.html 388979] |
− | + | * CHEBI: | |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15976 15976] | |
− | * | + | * LIGAND-CPD: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03230 C03230] |
− | + | {{#set: smiles=C2(=C(C1(C=CC=CC=1N2))C(O)C=O)}} | |
− | + | {{#set: common name=indole-3-glycol aldehyde}} | |
− | * | + | {{#set: inchi key=InChIKey=XKZDNWMDLGQXML-UHFFFAOYSA-N}} |
− | ** [http://www. | + | {{#set: molecular weight=175.187 }} |
− | + | {{#set: common name=2-hydroxy-2-(1H-indol-3-yl)acetaldehyde|3-indoleglycol aldehyde}} | |
− | + | {{#set: consumed by=RXN-5424}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 21:07, 21 March 2018
Contents
Metabolite 3-INDOLYLGLYCOLALDEHYDE
- smiles:
- C2(=C(C1(C=CC=CC=1N2))C(O)C=O)
- common name:
- indole-3-glycol aldehyde
- inchi key:
- InChIKey=XKZDNWMDLGQXML-UHFFFAOYSA-N
- molecular weight:
- 175.187
- Synonym(s):
- 2-hydroxy-2-(1H-indol-3-yl)acetaldehyde
- 3-indoleglycol aldehyde
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links