Difference between revisions of "RXN-11486"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12259 CPD-12259] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CC...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11486 RXN-11486] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12259 CPD-12259] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11486 RXN-11486] ==
−
* smiles:
+
* direction:
−
** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCOP([O-])(=O)OP([O-])(=O)OC4(OC(CO)C(OC3(OC(CO)C(OC2(OC(CO)C(OC1(OC(CO)C(O)C(O)C(NC(=O)C)1))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CNC(CNC(CNC(CNC(C[N+])=O)=O)=O)=O)=O)C(NC(C)C(NC(C(=O)[O-])C)=O)=O)C(=O)N)C(NC(C)=O)2))C(O)C(NC(=O)C)3))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CNC(CNC(CNC(CNC(C[N+])=O)=O)=O)=O)=O)C(NC(C)C(NC(C(=O)[O-])C)=O)=O)C(=O)N)C(NC(C)=O)4))C)C)C)C)C)C
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=YDLQGHNIONNLSM-SHGYSNKBSA-L
+
** [http://enzyme.expasy.org/EC/2.5.1.85 EC-2.5.1.85]
−
* common name:
+
−
** a peptidoglycan dimer (S. aureus)
+
−
* molecular weight:
+
−
** 3391.761   
+
 
* Synonym(s):
 
* Synonym(s):
−
** [N-acetylglucosamine-N-acetylmuramoyl-L-alanyl-D-glutamyl-L-lysyl-(Gly5)-D-alanyl-D-alanine]2 diphospho-undecaprenyl
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-11065]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 5 [[DELTA3-ISOPENTENYL-PP]][c] '''+''' 1 [[GERANYLGERANYL-PP]][c] '''=>''' 1 [[SOLANESYL-PYROPHOSPHATE]][c] '''+''' 5 [[PPI]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 5 isopentenyl diphosphate[c] '''+''' 1 geranylgeranyl diphosphate[c] '''=>''' 1 all-trans-nonaprenyl diphosphate[c] '''+''' 5 diphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_2848]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_18201]]
 +
** Source: [[orthology-synechocystis]]
 +
== Pathways  ==
 +
* [[PWY-6520]], nonaprenyl diphosphate biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6520 PWY-6520]
 +
** '''1''' reactions found over '''1''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659087 90659087]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27594 27594]
−
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCOP([O-])(=O)OP([O-])(=O)OC4(OC(CO)C(OC3(OC(CO)C(OC2(OC(CO)C(OC1(OC(CO)C(O)C(O)C(NC(=O)C)1))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CNC(CNC(CNC(CNC(C[N+])=O)=O)=O)=O)=O)C(NC(C)C(NC(C(=O)[O-])C)=O)=O)C(=O)N)C(NC(C)=O)2))C(O)C(NC(=O)C)3))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CNC(CNC(CNC(CNC(C[N+])=O)=O)=O)=O)=O)C(NC(C)C(NC(C(=O)[O-])C)=O)=O)C(=O)N)C(NC(C)=O)4))C)C)C)C)C)C}}
+
* LIGAND-RXN:
−
{{#set: inchi key=InChIKey=YDLQGHNIONNLSM-SHGYSNKBSA-L}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R09251 R09251]
−
{{#set: common name=a peptidoglycan dimer (S. aureus)}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: molecular weight=3391.761    }}
+
{{#set: ec number=EC-2.5.1.85}}
−
{{#set: common name=[N-acetylglucosamine-N-acetylmuramoyl-L-alanyl-D-glutamyl-L-lysyl-(Gly5)-D-alanyl-D-alanine]2 diphospho-undecaprenyl}}
+
{{#set: gene associated=Tiso_gene_2848|Tiso_gene_18201}}
−
{{#set: consumed by=RXN-11065}}
+
{{#set: in pathway=PWY-6520}}
 +
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction source=orthology-synechocystis|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph}}

Latest revision as of 20:07, 21 March 2018

Reaction RXN-11486

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6520, nonaprenyl diphosphate biosynthesis II: PWY-6520
    • 1 reactions found over 1 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-11486&oldid=46062"