Difference between revisions of "Tiso gene 3818"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-OXOPIMELOYL-COA 3-OXOPIMELOYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])...")
(Created page with "Category:Gene == Gene Tiso_gene_3818 == * Synonym(s): == Reactions associated == * Reaction: PROTEIN-KINASE-RXN ** Source: orthology-esiliculosus == Pathways asso...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-OXOPIMELOYL-COA 3-OXOPIMELOYL-COA] ==
+
== Gene Tiso_gene_3818 ==
* smiles:
+
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=KJXFOFKTZDJLMQ-UYRKPTJQSA-I
+
* common name:
+
** 3-oxopimeloyl-CoA
+
* molecular weight:
+
** 918.632   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-oxopimelyl-CoA
 
** 3-ketopimeloyl-CoA
 
** 3-ketopimelyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PROTEIN-KINASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-esiliculosus]]
* [[RXN-8032]]
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266579 45266579]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57350 57350]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C06715 C06715]
+
* HMDB : HMDB12158
+
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=KJXFOFKTZDJLMQ-UYRKPTJQSA-I}}
+
{{#set: common name=3-oxopimeloyl-CoA}}
+
{{#set: molecular weight=918.632    }}
+
{{#set: common name=3-oxopimelyl-CoA|3-ketopimeloyl-CoA|3-ketopimelyl-CoA}}
+
{{#set: reversible reaction associated=RXN-8032}}
+

Latest revision as of 20:07, 21 March 2018

Gene Tiso_gene_3818

  • Synonym(s):

Reactions associated

Pathways associated

External links