Difference between revisions of "Tiso gene 15416"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-316 CPD-316] == * smiles: ** CC1(=C(C=C2(C(=C1)NC3(C(N2CC(O)C(O)C(O)CO)=NC(NC3=O)=O)))C) *...")
(Created page with "Category:Gene == Gene Tiso_gene_15416 == * right end position: ** 2370 * transcription direction: ** POSITIVE * left end position: ** 3 * centisome position: ** 5.96421500...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-316 CPD-316] ==
+
== Gene Tiso_gene_15416 ==
−
* smiles:
+
* right end position:
−
** CC1(=C(C=C2(C(=C1)NC3(C(N2CC(O)C(O)C(O)CO)=NC(NC3=O)=O)))C)
+
** 2370
−
* inchi key:
+
* transcription direction:
−
** InChIKey=UTKDOUCGQVLJIN-PIGZVRMJSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** reduced riboflavin
+
** 3
−
* molecular weight:
+
* centisome position:
−
** 378.384   
+
** 5.964215000e-2
 
* Synonym(s):
 
* Synonym(s):
−
** 4a,5-dihydroriboflavine
 
−
** 7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-4a,5-dihydroisoalloxazine
 
−
** 7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-5,10-dihydrobenzo[g]pteridine-2,4(3H,4aH)-dione
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN0-1281]]
−
* [[RXN-12445]]
+
** Source: [[annotation-in-silico_annotation]]
−
* [[NADPH-DEHYDROGENASE-FLAVIN-RXN]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: automated-name-match
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2370}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45480537 45480537]
+
{{#set: transcription direction=POSITIVE}}
−
* HMDB : HMDB01557
+
{{#set: left end position=3}}
−
* LIGAND-CPD:
+
{{#set: centisome position=5.964215000e-2}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01007 C01007]
+
{{#set: reaction associated=RXN0-1281}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.52885.html 52885]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=8798 8798]
+
−
* BIGG : rbflvrd
+
−
{{#set: smiles=CC1(=C(C=C2(C(=C1)NC3(C(N2CC(O)C(O)C(O)CO)=NC(NC3=O)=O)))C)}}
+
−
{{#set: inchi key=InChIKey=UTKDOUCGQVLJIN-PIGZVRMJSA-N}}
+
−
{{#set: common name=reduced riboflavin}}
+
−
{{#set: molecular weight=378.384    }}
+
−
{{#set: common name=4a,5-dihydroriboflavine|7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-4a,5-dihydroisoalloxazine|7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-5,10-dihydrobenzo[g]pteridine-2,4(3H,4aH)-dione}}
+
−
{{#set: produced by=RXN-12445|NADPH-DEHYDROGENASE-FLAVIN-RXN}}
+

Latest revision as of 20:07, 21 March 2018

Gene Tiso_gene_15416

  • right end position:
    • 2370
  • transcription direction:
    • POSITIVE
  • left end position:
    • 3
  • centisome position:
    • 5.964215000e-2
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_15416&oldid=46073"