Difference between revisions of "S-ubi-N-term-specific-UCP-E2-L-cysteine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAL_PHOSPHATE PYRIDOXAL_PHOSPHATE] == * smiles: ** CC1(N=CC(=C(C=1O)C=O)COP(=O)([O-])[O-]...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ubi-N-term-specific-UCP-E2-L-cysteine S-ubi-N-term-specific-UCP-E2-L-cysteine] == * common na...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAL_PHOSPHATE PYRIDOXAL_PHOSPHATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ubi-N-term-specific-UCP-E2-L-cysteine S-ubi-N-term-specific-UCP-E2-L-cysteine] ==
* smiles:
+
** CC1(N=CC(=C(C=1O)C=O)COP(=O)([O-])[O-])
+
 
* common name:
 
* common name:
** pyridoxal 5'-phosphate
+
** an S-ubiquitinyl-[an N-terminal E2 ubiquitin-conjugating enzyme]-L-cysteine
* inchi key:
+
** InChIKey=NGVDGCNFYWLIFO-UHFFFAOYSA-L
+
* molecular weight:
+
** 245.128   
+
 
* Synonym(s):
 
* Synonym(s):
** PLP
+
** an S-ubiquitinyl-[an N-terminal ubiquitin-conjugating enzyme E2]-L-cysteine
** pyridoxal phosphate
+
** pyridoxal-5P
+
** pyridoxal 5-phosphate
+
** pyridoxal-P
+
** vitamin B6
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.3.74-RXN]]
+
* [[RXN-15564]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PNPOXI-RXN]]
+
* [[RXN-15563]]
* [[PMPOXI-RXN]]
+
* [[PYRIDOXKIN-RXN]]
+
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* CAS : 54-47-7
+
{{#set: common name=an S-ubiquitinyl-[an N-terminal E2 ubiquitin-conjugating enzyme]-L-cysteine}}
* BIGG : pydx5p
+
{{#set: common name=an S-ubiquitinyl-[an N-terminal ubiquitin-conjugating enzyme E2]-L-cysteine}}
* PUBCHEM:
+
{{#set: consumed by=RXN-15564}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=644168 644168]
+
{{#set: produced by=RXN-15563}}
* HMDB : HMDB01491
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00018 C00018]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.559203.html 559203]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=597326 597326]
+
* METABOLIGHTS : MTBLC597326
+
{{#set: smiles=CC1(N=CC(=C(C=1O)C=O)COP(=O)([O-])[O-])}}
+
{{#set: common name=pyridoxal 5'-phosphate}}
+
{{#set: inchi key=InChIKey=NGVDGCNFYWLIFO-UHFFFAOYSA-L}}
+
{{#set: molecular weight=245.128    }}
+
{{#set: common name=PLP|pyridoxal phosphate|pyridoxal-5P|pyridoxal 5-phosphate|pyridoxal-P|vitamin B6}}
+
{{#set: consumed by=3.1.3.74-RXN}}
+
{{#set: produced by=PNPOXI-RXN|PMPOXI-RXN|PYRIDOXKIN-RXN}}
+

Latest revision as of 21:07, 21 March 2018

Metabolite S-ubi-N-term-specific-UCP-E2-L-cysteine

  • common name:
    • an S-ubiquitinyl-[an N-terminal E2 ubiquitin-conjugating enzyme]-L-cysteine
  • Synonym(s):
    • an S-ubiquitinyl-[an N-terminal ubiquitin-conjugating enzyme E2]-L-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an S-ubiquitinyl-[an N-terminal E2 ubiquitin-conjugating enzyme]-L-cysteine" cannot be used as a page name in this wiki.
"an S-ubiquitinyl-[an N-terminal ubiquitin-conjugating enzyme E2]-L-cysteine" cannot be used as a page name in this wiki.