Difference between revisions of "Tiso gene 13748"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-414 CPD-414] == * smiles: ** CC(NC1(C(CC(OC1C(O)C(O)CO)(C([O-])=O)O)OC(C)=O))=O * inchi key...")
(Created page with "Category:Gene == Gene Tiso_gene_13748 == * right end position: ** 3521 * transcription direction: ** POSITIVE * left end position: ** 523 * centisome position: ** 8.558337...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-414 CPD-414] ==
+
== Gene Tiso_gene_13748 ==
−
* smiles:
+
* right end position:
−
** CC(NC1(C(CC(OC1C(O)C(O)CO)(C([O-])=O)O)OC(C)=O))=O
+
** 3521
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LVBIMVQYUKOENY-FODKYPIKSA-M
+
** POSITIVE
−
* common name:
+
* left end position:
−
** N-acetyl-4-O-acetylneuraminate
+
** 523
−
* molecular weight:
+
* centisome position:
−
** 350.302    
+
** 8.558337    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-13181]]
+
* Reaction: [[TREHALA-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY0-1182]]
 +
* [[PWY0-1466]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=3521}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244557 25244557]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=523}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29006 29006]
+
{{#set: centisome position=8.558337    }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=TREHALA-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04015 C04015]
+
{{#set: pathway associated=PWY0-1182|PWY0-1466}}
−
* HMDB : HMDB00796
+
−
{{#set: smiles=CC(NC1(C(CC(OC1C(O)C(O)CO)(C([O-])=O)O)OC(C)=O))=O}}
+
−
{{#set: inchi key=InChIKey=LVBIMVQYUKOENY-FODKYPIKSA-M}}
+
−
{{#set: common name=N-acetyl-4-O-acetylneuraminate}}
+
−
{{#set: molecular weight=350.302    }}
+
−
{{#set: consumed by=RXN-13181}}
+

Latest revision as of 21:07, 21 March 2018

Gene Tiso_gene_13748

  • right end position:
    • 3521
  • transcription direction:
    • POSITIVE
  • left end position:
    • 523
  • centisome position:
    • 8.558337
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_13748&oldid=46137"