Difference between revisions of "CPD-19491"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_4735 == * left end position: ** 6724 * transcription direction: ** POSITIVE * right end position: ** 8508 * centisome position: ** 46.73338...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19491 CPD-19491] == * smiles: ** C(C(CCCSC)C(=O)C(=O)[O-])(=O)[O-] * common name: ** 3-isop...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19491 CPD-19491] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(C(CCCSC)C(=O)C(=O)[O-])(=O)[O-] |
| − | * | + | * common name: |
| − | ** | + | ** 3-isopropyl-6-(methylthio)-2-oxohexanoate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=WRGKTDWHJSBCJR-UHFFFAOYSA-L |
| − | * | + | * molecular weight: |
| − | ** | + | ** 218.224 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-18209]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-18208]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: smiles=C(C(CCCSC)C(=O)C(=O)[O-])(=O)[O-]}} |
| − | {{#set: | + | {{#set: common name=3-isopropyl-6-(methylthio)-2-oxohexanoate}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=WRGKTDWHJSBCJR-UHFFFAOYSA-L}} |
| − | {{#set: | + | {{#set: molecular weight=218.224 }} |
| − | {{#set: | + | {{#set: consumed by=RXN-18209}} |
| − | {{#set: | + | {{#set: reversible reaction associated=RXN-18208}} |
Latest revision as of 20:07, 21 March 2018
Contents
Metabolite CPD-19491
- smiles:
- C(C(CCCSC)C(=O)C(=O)[O-])(=O)[O-]
- common name:
- 3-isopropyl-6-(methylthio)-2-oxohexanoate
- inchi key:
- InChIKey=WRGKTDWHJSBCJR-UHFFFAOYSA-L
- molecular weight:
- 218.224
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(CCCSC)C(=O)C(=O)[O-])(=O)[O-" cannot be used as a page name in this wiki.
