Difference between revisions of "CPD-11410"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17401 CPD-17401] == * smiles: ** CCC=CCCC(O)CC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11410 CPD-11410] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-]...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11410 CPD-11410] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C=C3)) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** triiodothyroacetate ether glucuronide |
+ | * inchi key: | ||
+ | ** InChIKey=VXVBZMWOWMHXTQ-KFYUBCHVSA-L | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 796.046 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** triiodothyroacetic acid ether glucuronide |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-10619]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659025 90659025] |
− | {{#set: smiles= | + | {{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C=C3))}} |
− | {{#set: | + | {{#set: common name=triiodothyroacetate ether glucuronide}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=VXVBZMWOWMHXTQ-KFYUBCHVSA-L}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=796.046 }} |
− | {{#set: common name= | + | {{#set: common name=triiodothyroacetic acid ether glucuronide}} |
− | {{#set: | + | {{#set: produced by=RXN-10619}} |
Latest revision as of 20:08, 21 March 2018
Contents
Metabolite CPD-11410
- smiles:
- C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C=C3))
- common name:
- triiodothyroacetate ether glucuronide
- inchi key:
- InChIKey=VXVBZMWOWMHXTQ-KFYUBCHVSA-L
- molecular weight:
- 796.046
- Synonym(s):
- triiodothyroacetic acid ether glucuronide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C=C3))" cannot be used as a page name in this wiki.