Difference between revisions of "CPD-18761"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ubi-N-term-specific-UCP-E2-L-cysteine S-ubi-N-term-specific-UCP-E2-L-cysteine] == * common na...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18761 CPD-18761] == * smiles: ** COC1(=CC(=CCCO)C=CC(=O)1) * common name: ** coniferyl alco...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ubi-N-term-specific-UCP-E2-L-cysteine S-ubi-N-term-specific-UCP-E2-L-cysteine] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18761 CPD-18761] ==
 +
* smiles:
 +
** COC1(=CC(=CCCO)C=CC(=O)1)
 
* common name:
 
* common name:
** an S-ubiquitinyl-[an N-terminal E2 ubiquitin-conjugating enzyme]-L-cysteine
+
** coniferyl alcohol radical
 +
* inchi key:
 +
** InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N
 +
* molecular weight:
 +
** 179.195   
 
* Synonym(s):
 
* Synonym(s):
** an S-ubiquitinyl-[an N-terminal ubiquitin-conjugating enzyme E2]-L-cysteine
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15564]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15563]]
+
* [[RXN-17352]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=an S-ubiquitinyl-[an N-terminal E2 ubiquitin-conjugating enzyme]-L-cysteine}}
+
{{#set: smiles=COC1(=CC(=CCCO)C=CC(=O)1)}}
{{#set: common name=an S-ubiquitinyl-[an N-terminal ubiquitin-conjugating enzyme E2]-L-cysteine}}
+
{{#set: common name=coniferyl alcohol radical}}
{{#set: consumed by=RXN-15564}}
+
{{#set: inchi key=InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N}}
{{#set: produced by=RXN-15563}}
+
{{#set: molecular weight=179.195    }}
 +
{{#set: produced by=RXN-17352}}

Latest revision as of 20:08, 21 March 2018

Metabolite CPD-18761

  • smiles:
    • COC1(=CC(=CCCO)C=CC(=O)1)
  • common name:
    • coniferyl alcohol radical
  • inchi key:
    • InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N
  • molecular weight:
    • 179.195
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links