Difference between revisions of "CPD-11529"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_12198 == * left end position: ** 73 * transcription direction: ** NEGATIVE * right end position: ** 5134 * centisome position: ** 1.0102408...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11529 CPD-11529] == * smiles: ** CCC=CCC4(C(=O)CCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_12198 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11529 CPD-11529] ==
* left end position:
+
* smiles:
** 73
+
** CCC=CCC4(C(=O)CCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
* transcription direction:
+
* common name:
** NEGATIVE
+
** jasmonoyl-CoA
* right end position:
+
* inchi key:
** 5134
+
** InChIKey=WQKKCPPNDKSAIU-PCDAEQFSSA-J
* centisome position:
+
* molecular weight:
** 1.0102408    
+
** 955.76    
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[5.4.99.17-RXN]]
+
* [[RXN-10708]]
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
***ec-number
+
* [[RXN-10701]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
* [[PWY-7072]]
+
* [[PWY-6098]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=73}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237154 44237154]
{{#set: right end position=5134}}
+
{{#set: smiles=CCC=CCC4(C(=O)CCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
{{#set: centisome position=1.0102408   }}
+
{{#set: common name=jasmonoyl-CoA}}
{{#set: reaction associated=5.4.99.17-RXN}}
+
{{#set: inchi key=InChIKey=WQKKCPPNDKSAIU-PCDAEQFSSA-J}}
{{#set: pathway associated=PWY-7072|PWY-6098}}
+
{{#set: molecular weight=955.76   }}
 +
{{#set: consumed by=RXN-10708}}
 +
{{#set: produced by=RXN-10701}}

Latest revision as of 21:08, 21 March 2018

Metabolite CPD-11529

  • smiles:
    • CCC=CCC4(C(=O)CCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
  • common name:
    • jasmonoyl-CoA
  • inchi key:
    • InChIKey=WQKKCPPNDKSAIU-PCDAEQFSSA-J
  • molecular weight:
    • 955.76
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC=CCC4(C(=O)CCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)" cannot be used as a page name in this wiki.