Difference between revisions of "CPD-11529"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Kinesin-Microtubules-Complex Kinesin-Microtubules-Complex] == * common name: ** a kinesin-micro...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11529 CPD-11529] == * smiles: ** CCC=CCC4(C(=O)CCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Kinesin-Microtubules-Complex Kinesin-Microtubules-Complex] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11529 CPD-11529] ==
 +
* smiles:
 +
** CCC=CCC4(C(=O)CCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
 
* common name:
 
* common name:
** a kinesin-microtubules complex
+
** jasmonoyl-CoA
 +
* inchi key:
 +
** InChIKey=WQKKCPPNDKSAIU-PCDAEQFSSA-J
 +
* molecular weight:
 +
** 955.76   
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.6.4.4-RXN]]
+
* [[RXN-10708]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.6.4.4-RXN]]
+
* [[RXN-10701]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a kinesin-microtubules complex}}
+
* PUBCHEM:
{{#set: consumed by=3.6.4.4-RXN}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237154 44237154]
{{#set: produced by=3.6.4.4-RXN}}
+
{{#set: smiles=CCC=CCC4(C(=O)CCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
 +
{{#set: common name=jasmonoyl-CoA}}
 +
{{#set: inchi key=InChIKey=WQKKCPPNDKSAIU-PCDAEQFSSA-J}}
 +
{{#set: molecular weight=955.76    }}
 +
{{#set: consumed by=RXN-10708}}
 +
{{#set: produced by=RXN-10701}}

Latest revision as of 20:08, 21 March 2018

Metabolite CPD-11529

  • smiles:
    • CCC=CCC4(C(=O)CCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
  • common name:
    • jasmonoyl-CoA
  • inchi key:
    • InChIKey=WQKKCPPNDKSAIU-PCDAEQFSSA-J
  • molecular weight:
    • 955.76
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC=CCC4(C(=O)CCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)" cannot be used as a page name in this wiki.