Difference between revisions of "INORGPYROPHOSPHAT-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18761 CPD-18761] == * smiles: ** COC1(=CC(=CCCO)C=CC(=O)1) * inchi key: ** InChIKey=ORAJWSY...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=INORGPYROPHOSPHAT-RXN INORGPYROPHOSPHAT-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Tra...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=INORGPYROPHOSPHAT-RXN INORGPYROPHOSPHAT-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Transmembrane_protein |
− | * | + | ** inorganic_pyrophosphatase |
− | ** | + | ** ORF |
+ | ** h+-translocating_pyrophosphatase | ||
+ | ** Inorganic pyrophosphatase | ||
+ | ** mitochondrial_carrier_protein | ||
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/3.6.1.1 EC-3.6.1.1] | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[PPI]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[PROTON]][c] '''+''' 2 [[Pi]][c] |
− | == | + | * With common name(s): |
+ | ** 1 diphosphate[c] '''+''' 1 H2O[c] '''=>''' 1 H+[c] '''+''' 2 phosphate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_2850]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_6277]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_15874]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_16197]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_2851]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_17878]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Tiso_gene_16375]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_9490]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Gene: [[Tiso_gene_17879]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_7014]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Gene: [[Tiso_gene_17889]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_1110]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | == Pathways == | ||
+ | * [[PWY-7805]], aminomethylphosphonate degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7805 PWY-7805] | ||
+ | ** '''2''' reactions found over '''8''' reactions in the full pathway | ||
+ | * [[PWY-7807]], glyphosate degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7807 PWY-7807] | ||
+ | ** '''2''' reactions found over '''7''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[manual]] | ||
+ | ** Source: [[manual-primary_network]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | {{#set: | + | * RHEA: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24576 24576] |
− | {{#set: common name= | + | * LIGAND-RXN: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00004 R00004] |
− | {{#set: | + | * UNIPROT: |
+ | ** [http://www.uniprot.org/uniprot/P21616 P21616] | ||
+ | ** [http://www.uniprot.org/uniprot/P31414 P31414] | ||
+ | ** [http://www.uniprot.org/uniprot/P28239 P28239] | ||
+ | ** [http://www.uniprot.org/uniprot/P37980 P37980] | ||
+ | ** [http://www.uniprot.org/uniprot/P84491 P84491] | ||
+ | ** [http://www.uniprot.org/uniprot/O59570 O59570] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9S941 Q9S941] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9S939 Q9S939] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9S936 Q9S936] | ||
+ | ** [http://www.uniprot.org/uniprot/O26363 O26363] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9S940 Q9S940] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9S938 Q9S938] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9S937 Q9S937] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9PHM9 Q9PHM9] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9UY24 Q9UY24] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9JVG3 Q9JVG3] | ||
+ | ** [http://www.uniprot.org/uniprot/P47593 P47593] | ||
+ | ** [http://www.uniprot.org/uniprot/Q974Y8 Q974Y8] | ||
+ | ** [http://www.uniprot.org/uniprot/O05724 O05724] | ||
+ | ** [http://www.uniprot.org/uniprot/P19514 P19514] | ||
+ | ** [http://www.uniprot.org/uniprot/P00817 P00817] | ||
+ | ** [http://www.uniprot.org/uniprot/P0A7A9 P0A7A9] | ||
+ | ** [http://www.uniprot.org/uniprot/P13998 P13998] | ||
+ | ** [http://www.uniprot.org/uniprot/P19117 P19117] | ||
+ | ** [http://www.uniprot.org/uniprot/P21216 P21216] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9R5T3 Q9R5T3] | ||
+ | ** [http://www.uniprot.org/uniprot/P37981 P37981] | ||
+ | ** [http://www.uniprot.org/uniprot/Q43801 Q43801] | ||
+ | ** [http://www.uniprot.org/uniprot/Q43798 Q43798] | ||
+ | ** [http://www.uniprot.org/uniprot/Q43797 Q43797] | ||
+ | ** [http://www.uniprot.org/uniprot/P50308 P50308] | ||
+ | ** [http://www.uniprot.org/uniprot/Q43796 Q43796] | ||
+ | ** [http://www.uniprot.org/uniprot/P93409 P93409] | ||
+ | ** [http://www.uniprot.org/uniprot/Q8H616 Q8H616] | ||
+ | ** [http://www.uniprot.org/uniprot/P93410 P93410] | ||
+ | ** [http://www.uniprot.org/uniprot/P75250 P75250] | ||
+ | ** [http://www.uniprot.org/uniprot/Q49071 Q49071] | ||
+ | ** [http://www.uniprot.org/uniprot/O48556 O48556] | ||
+ | ** [http://www.uniprot.org/uniprot/O22537 O22537] | ||
+ | ** [http://www.uniprot.org/uniprot/O82793 O82793] | ||
+ | ** [http://www.uniprot.org/uniprot/O23979 O23979] | ||
+ | ** [http://www.uniprot.org/uniprot/O49949 O49949] | ||
+ | ** [http://www.uniprot.org/uniprot/Q43187 Q43187] | ||
+ | ** [http://www.uniprot.org/uniprot/O22124 O22124] | ||
+ | ** [http://www.uniprot.org/uniprot/Q42650 Q42650] | ||
+ | ** [http://www.uniprot.org/uniprot/Q42651 Q42651] | ||
+ | ** [http://www.uniprot.org/uniprot/O65151 O65151] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=Transmembrane_protein}} | ||
+ | {{#set: common name=inorganic_pyrophosphatase}} | ||
+ | {{#set: common name=ORF}} | ||
+ | {{#set: common name=h+-translocating_pyrophosphatase}} | ||
+ | {{#set: common name=Inorganic pyrophosphatase}} | ||
+ | {{#set: common name=mitochondrial_carrier_protein}} | ||
+ | {{#set: ec number=EC-3.6.1.1}} | ||
+ | {{#set: gene associated=Tiso_gene_2850|Tiso_gene_6277|Tiso_gene_15874|Tiso_gene_16197|Tiso_gene_2851|Tiso_gene_17878|Tiso_gene_16375|Tiso_gene_9490|Tiso_gene_17879|Tiso_gene_7014|Tiso_gene_17889|Tiso_gene_1110}} | ||
+ | {{#set: in pathway=PWY-7805|PWY-7807}} | ||
+ | {{#set: reconstruction category=orthology|manual|annotation}} | ||
+ | {{#set: reconstruction source=annotation-experimental_annotation|orthology-esiliculosus|annotation-in-silico_annotation|orthology-athaliana|orthology-synechocystis|manual-primary_network|orthology-creinhardtii}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 20:08, 21 March 2018
Contents
Reaction INORGPYROPHOSPHAT-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- Transmembrane_protein
- inorganic_pyrophosphatase
- ORF
- h+-translocating_pyrophosphatase
- Inorganic pyrophosphatase
- mitochondrial_carrier_protein
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 diphosphate[c] + 1 H2O[c] => 1 H+[c] + 2 phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_2850
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_6277
- Source: orthology-esiliculosus
- Gene: Tiso_gene_15874
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_16197
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_2851
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_17878
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_16375
- Source: orthology-esiliculosus
- Gene: Tiso_gene_9490
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_17879
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-experimental_annotation
- Gene: Tiso_gene_7014
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Source: orthology-creinhardtii
- Source: annotation-experimental_annotation
- Gene: Tiso_gene_17889
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_1110
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: annotation-experimental_annotation
Pathways
- PWY-7805, aminomethylphosphonate degradation: PWY-7805
- 2 reactions found over 8 reactions in the full pathway
- PWY-7807, glyphosate degradation III: PWY-7807
- 2 reactions found over 7 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-athaliana
- Category: manual
- Source: manual-primary_network
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT:
- P21616
- P31414
- P28239
- P37980
- P84491
- O59570
- Q9S941
- Q9S939
- Q9S936
- O26363
- Q9S940
- Q9S938
- Q9S937
- Q9PHM9
- Q9UY24
- Q9JVG3
- P47593
- Q974Y8
- O05724
- P19514
- P00817
- P0A7A9
- P13998
- P19117
- P21216
- Q9R5T3
- P37981
- Q43801
- Q43798
- Q43797
- P50308
- Q43796
- P93409
- Q8H616
- P93410
- P75250
- Q49071
- O48556
- O22537
- O82793
- O23979
- O49949
- Q43187
- O22124
- Q42650
- Q42651
- O65151