Difference between revisions of "RXN-10614"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=APS APS] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OS(=O)([O-])=O)([O-])...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10614 RXN-10614] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=APS APS] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10614 RXN-10614] ==
−
* smiles:
+
* direction:
−
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OS(=O)([O-])=O)([O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=IRLPACMLTUPBCL-KQYNXXCUSA-L
+
** [http://enzyme.expasy.org/EC/2.8.2.1 EC-2.8.2.1]
−
* common name:
+
−
** adenosine 5'-phosphosulfate
+
−
* molecular weight:
+
−
** 425.266   
+
 
* Synonym(s):
 
* Synonym(s):
−
** adenylyl-sulfate
 
−
** APS
 
−
** adenosine phosphosulfate
 
−
** adenosine 5'-sulphatophosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[ADENYLYLSULFATASE-RXN]]
+
* With identifiers:
−
* [[AASP]]
+
** 1 [[L-THYROXINE]][c] '''+''' 1 [[PAPS]][c] '''=>''' 1 [[3-5-ADP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-11407]][c]
−
* [[1.8.4.9-RXN]]
+
* With common name(s):
−
== Reaction(s) known to produce the compound ==
+
** 1 L-thyroxine[c] '''+''' 1 3'-phosphoadenylyl-sulfate[c] '''=>''' 1 adenosine 3',5'-bisphosphate[c] '''+''' 1 H+[c] '''+''' 1 thyroxine sulfate[c]
−
== Reaction(s) of unknown directionality ==
+
 
−
* [[R163-RXN]]
+
== Genes associated with this reaction  ==
−
* [[ADENYLYLSULFKIN-RXN]]
+
Genes have been associated with this reaction based on different elements listed below.
−
* [[SULFATE-ADENYLYLTRANS-RXN]]
+
* Gene: [[Tiso_gene_5505]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-6261]], thyroid hormone metabolism II (via conjugation and/or degradation): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6261 PWY-6261]
 +
** '''11''' reactions found over '''15''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 485-84-7
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* METABOLIGHTS : MTBLC58243
+
{{#set: ec number=EC-2.8.2.1}}
−
* PUBCHEM:
+
{{#set: gene associated=Tiso_gene_5505}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852317 49852317]
+
{{#set: in pathway=PWY-6261}}
−
* HMDB : HMDB01003
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00224 C00224]
+
{{#set: reconstruction tool=pantograph}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58243 58243]
+
−
* BIGG : aps
+
−
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OS(=O)([O-])=O)([O-])=O}}
+
−
{{#set: inchi key=InChIKey=IRLPACMLTUPBCL-KQYNXXCUSA-L}}
+
−
{{#set: common name=adenosine 5'-phosphosulfate}}
+
−
{{#set: molecular weight=425.266    }}
+
−
{{#set: common name=adenylyl-sulfate|APS|adenosine phosphosulfate|adenosine 5'-sulphatophosphate}}
+
−
{{#set: consumed by=ADENYLYLSULFATASE-RXN|AASP|1.8.4.9-RXN}}
+
−
{{#set: reversible reaction associated=R163-RXN|ADENYLYLSULFKIN-RXN|SULFATE-ADENYLYLTRANS-RXN}}
+

Latest revision as of 21:08, 21 March 2018

Reaction RXN-10614

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 L-thyroxine[c] + 1 3'-phosphoadenylyl-sulfate[c] => 1 adenosine 3',5'-bisphosphate[c] + 1 H+[c] + 1 thyroxine sulfate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6261, thyroid hormone metabolism II (via conjugation and/or degradation): PWY-6261
    • 11 reactions found over 15 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-10614&oldid=46230"