Difference between revisions of "PRO-tRNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9646 CPD-9646] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRO-tRNAs PRO-tRNAs] == * common name: ** a tRNApro * Synonym(s): ** TRNA(PRO) == Reaction(s)...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9646 CPD-9646] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRO-tRNAs PRO-tRNAs] ==
* smiles:
+
** CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])[O-])C)C)C
+
* inchi key:
+
** InChIKey=UFPHFKCTOZIAFY-NTDVEAECSA-L
+
 
* common name:
 
* common name:
** di-trans,octa-cis-undecaprenyl phosphate
+
** a tRNApro
* molecular weight:
+
** 845.279   
+
 
* Synonym(s):
 
* Synonym(s):
** ditrans,polycis-undecaprenyl phosphate
+
** TRNA(PRO)
** ditrans,octacis-undecaprenyl phosphate
+
** C55-P
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11347]]
+
* [[PROLINE--TRNA-LIGASE-RXN]]
* [[PHOSNACMURPENTATRANS-RXN]]
+
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-8975]]
 
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: common name=a tRNApro}}
** [http://www.genome.jp/dbget-bin/www_bget?C17556 C17556]
+
{{#set: common name=TRNA(PRO)}}
* CHEBI:
+
{{#set: consumed by=PROLINE--TRNA-LIGASE-RXN}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60392 60392]
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245635 25245635]
+
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])[O-])C)C)C}}
+
{{#set: inchi key=InChIKey=UFPHFKCTOZIAFY-NTDVEAECSA-L}}
+
{{#set: common name=di-trans,octa-cis-undecaprenyl phosphate}}
+
{{#set: molecular weight=845.279    }}
+
{{#set: common name=ditrans,polycis-undecaprenyl phosphate|ditrans,octacis-undecaprenyl phosphate|C55-P}}
+
{{#set: consumed by=RXN-11347|PHOSNACMURPENTATRANS-RXN}}
+
{{#set: reversible reaction associated=RXN-8975}}
+

Latest revision as of 20:08, 21 March 2018

Metabolite PRO-tRNAs

  • common name:
    • a tRNApro
  • Synonym(s):
    • TRNA(PRO)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links