Difference between revisions of "3-HEXAPRENYL-4-HYDROXYBENZOATE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_8102 == * left end position: ** 85 * transcription direction: ** POSITIVE * right end position: ** 1804 * centisome position: ** 0.80875355...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HEXAPRENYL-4-HYDROXYBENZOATE 3-HEXAPRENYL-4-HYDROXYBENZOATE] == * smiles: ** CC(C)=CCCC(=CCCC...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HEXAPRENYL-4-HYDROXYBENZOATE 3-HEXAPRENYL-4-HYDROXYBENZOATE] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C |
− | * | + | * common name: |
− | ** | + | ** 3-hexaprenyl-4-hydroxybenzoate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=LKMQQQABIGIHGL-LAAQXVIISA-M |
− | * | + | * molecular weight: |
− | ** | + | ** 545.824 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-9003]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[RXN- | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54740358 54740358] |
− | {{#set: | + | * HMDB : HMDB06816 |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84492 84492] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C13425 C13425] | ||
+ | {{#set: smiles=CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C}} | ||
+ | {{#set: common name=3-hexaprenyl-4-hydroxybenzoate}} | ||
+ | {{#set: inchi key=InChIKey=LKMQQQABIGIHGL-LAAQXVIISA-M}} | ||
+ | {{#set: molecular weight=545.824 }} | ||
+ | {{#set: produced by=RXN-9003}} |
Latest revision as of 20:08, 21 March 2018
Contents
Metabolite 3-HEXAPRENYL-4-HYDROXYBENZOATE
- smiles:
- CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C
- common name:
- 3-hexaprenyl-4-hydroxybenzoate
- inchi key:
- InChIKey=LKMQQQABIGIHGL-LAAQXVIISA-M
- molecular weight:
- 545.824
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C" cannot be used as a page name in this wiki.