Difference between revisions of "RXN-7665"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19491 CPD-19491] == * smiles: ** C(C(CCCSC)C(=O)C(=O)[O-])(=O)[O-] * common name: ** 3-isop...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7665 RXN-7665] == * direction: ** LEFT-TO-RIGHT * common name: ** geranylgeranyl_diphosphate_re...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7665 RXN-7665] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
| − | ** | + | ** geranylgeranyl_diphosphate_reductase |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-7004]][c] '''=>''' 1 [[CPD-7006]][c] '''+''' 1 [[NADP]][c] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 dihydrogeranylgeranyl chlorophyll a[c] '''=>''' 1 tetrahydrogeranylgeranyl chlorophyll a[c] '''+''' 1 NADP+[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_2613]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | ** Source: [[annotation-experimental_annotation]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | == Pathways == | ||
| + | * [[PWY-5064]], chlorophyll a biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5064 PWY-5064] | ||
| + | ** '''5''' reactions found over '''5''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-experimental_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | {{#set: common name= | + | {{#set: common name=geranylgeranyl_diphosphate_reductase}} |
| − | {{#set: | + | {{#set: gene associated=Tiso_gene_2613}} |
| − | {{#set: | + | {{#set: in pathway=PWY-5064}} |
| − | {{#set: | + | {{#set: reconstruction category=annotation}} |
| − | {{#set: | + | {{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}} |
| + | {{#set: reconstruction tool=pathwaytools}} | ||
Latest revision as of 21:08, 21 March 2018
Contents
Reaction RXN-7665
- direction:
- LEFT-TO-RIGHT
- common name:
- geranylgeranyl_diphosphate_reductase
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 NADPH[c] + 1 H+[c] + 1 dihydrogeranylgeranyl chlorophyll a[c] => 1 tetrahydrogeranylgeranyl chlorophyll a[c] + 1 NADP+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_2613
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-experimental_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
Pathways
- PWY-5064, chlorophyll a biosynthesis II: PWY-5064
- 5 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
