Difference between revisions of "GLUTAMATE-1-SEMIALDEHYDE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Phosphoserines Phosphoserines] == * common name: ** L(or D)-O-phosphoserine * Synonym(s): == R...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTAMATE-1-SEMIALDEHYDE GLUTAMATE-1-SEMIALDEHYDE] == * smiles: ** [CH](C(CCC([O-])=O)[N+])=O *...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTAMATE-1-SEMIALDEHYDE GLUTAMATE-1-SEMIALDEHYDE] == |
+ | * smiles: | ||
+ | ** [CH](C(CCC([O-])=O)[N+])=O | ||
* common name: | * common name: | ||
− | ** | + | ** (S)-4-amino-5-oxopentanoate |
+ | * inchi key: | ||
+ | ** InChIKey=MPUUQNGXJSEWTF-BYPYZUCNSA-N | ||
+ | * molecular weight: | ||
+ | ** 131.131 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** L-glutamate 1-semialdehyde | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[GSAAMINOTRANS-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[GLUTRNAREDUCT-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: consumed by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244684 25244684] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57501 57501] | ||
+ | * BIGG : glu1sa | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C03741 C03741] | ||
+ | {{#set: smiles=[CH](C(CCC([O-])=O)[N+])=O}} | ||
+ | {{#set: common name=(S)-4-amino-5-oxopentanoate}} | ||
+ | {{#set: inchi key=InChIKey=MPUUQNGXJSEWTF-BYPYZUCNSA-N}} | ||
+ | {{#set: molecular weight=131.131 }} | ||
+ | {{#set: common name=L-glutamate 1-semialdehyde}} | ||
+ | {{#set: consumed by=GSAAMINOTRANS-RXN}} | ||
+ | {{#set: produced by=GLUTRNAREDUCT-RXN}} |
Latest revision as of 20:08, 21 March 2018
Contents
Metabolite GLUTAMATE-1-SEMIALDEHYDE
- smiles:
- [CH](C(CCC([O-])=O)[N+])=O
- common name:
- (S)-4-amino-5-oxopentanoate
- inchi key:
- InChIKey=MPUUQNGXJSEWTF-BYPYZUCNSA-N
- molecular weight:
- 131.131
- Synonym(s):
- L-glutamate 1-semialdehyde
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](C(CCC([O-])=O)[N+])=O" cannot be used as a page name in this wiki.